
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14548-40-4 |
| Catalog No. | 2A-9036258 |
| Chinese Name | 6-碘-1-茚满酮 |
| Synonyms | 6-Iodo-1-indanone; 6-iodoindan-1-one; 6-iodo-2,3-dihydroinden-1-one; 6-Iodindan-1-on |
| Molecular Formula | C9H7O1I1 |
| Molecular Weight | 258.06 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 314.0±31.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 90344177 |
| MDL Number | MFCD09744087 |
| SMILES | O=C1CCc2ccc(I)cc21 |
| InChI | InChI=1S/C9H7IO/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5H,2,4H2 |
| InChI Key | CIMZMDUWHIFAHN-UHFFFAOYSA-N |
| MSDS | msds/36258_1_14548_40_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium 1-propanesulfonate | 14533-63-2 | 2A-9036245 |
| Pentafluorophenyl trifluoroacetate | 14533-84-7 | 2A-9036246 |
| 4-Amino-3-mercaptobenzoic acid | 14543-45-4 | 2A-9036255 |
| 6-Chloro-1-indanone | 14548-38-0 | 2A-9036256 |
| 6-Bromoindanone | 14548-39-1 | 2A-9036257 |
| 7-Chloro-3,4-dihydro-1H-quinolin-2-one | 14548-50-6 | 2A-9036260 |
| 4-Aminobenzenepropanol | 14572-92-0 | 2A-9036266 |
| 2,6-Dichlorophenethylamine | 14573-23-0 | 2A-9036267 |
| D-3-Bromocamphor-8-sulfonic acid ammonium salt | 14575-84-9 | 2A-9036268 |
| 1-(2-Chlorophenyl)-3-methyl-2-pyrazolin-5-one | 14580-22-4 | 2A-9036269 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA