
CAS Number14510-37-3
Synonymsacetyltropyl chloride; O-acetyltropoyl chloride; I01-3177; 3-Acetoxy-2-phenyl-propionsaeure-chlorid; Acetyltropylic chloride; 3-acetoxy-2-phenyl-propionyl chloride
Molecular FormulaC11H11ClO3
Molecular Weight226.65600
Purity98.00%
Density1.228
Boiling Point319ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14510-37-3 |
| Catalog No. | 2A-9036232 |
| Chinese Name | 乙酰托品酰氯 |
| Synonyms | acetyltropyl chloride; O-acetyltropoyl chloride; I01-3177; 3-Acetoxy-2-phenyl-propionsaeure-chlorid; Acetyltropylic chloride; 3-acetoxy-2-phenyl-propionyl chloride |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.65600 |
| Purity | 98.00 |
| Density | 1.228 |
| Boiling Point | 319ºC |
| HTC | 2915390090 |
| PubChem ID | 15936599 |
| SMILES | CC(=O)OCC(C(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H11ClO3/c1-8(13)15-7-10(11(12)14)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChI Key | PWWISFVVAKCNEF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Chlorophenyl)cyclohexanone | 14472-80-1 | 2A-9036212 |
| 3-Chlorocinnamic acid | 14473-90-6 | 2A-9036213 |
| Ferbam | 14484-64-1 | 2A-9036218 |
| 7-Methyltryptamine | 14490-05-2 | 2A-9036224 |
| Steapyrium chloride | 14492-68-3 | 2A-9036226 |
| 3-Methacryloxypropylmethyldimethoxysilane | 14513-34-9 | 2A-9036233 |
| 2,2'-Thiobis(4-tert-octylphenolato)-n-butylamine nickel(II) | 14516-71-3 | 2A-9036235 |
| Rhodium carbonyl chloride | 14523-22-9 | 2A-9036237 |
| 5-Chloro-N-methylisatoic anhydride | 14529-12-5 | 2A-9036241 |
| 3,5-Dibromo-1-methylpyridin-2(1H)-one | 14529-54-5 | 2A-9036243 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA