
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14472-80-1 |
| Catalog No. | 2A-9036212 |
| Chinese Name | 4-(4-氯苯基)-环己酮 |
| Synonyms | 4-(4-Chlorophenyl)cyclohexanone; 4-(4-chlorophenyl)cyclohexan-1-one |
| Molecular Formula | C12H13O1Cl1 |
| Molecular Weight | 208.69 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 323.7±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2914700090 |
| PubChem ID | 38240081 |
| MDL Number | MFCD11850091 |
| SMILES | O=C1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C12H13ClO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-2,5-6,10H,3-4,7-8H2 |
| InChI Key | JNBOVWFOTNYTES-UHFFFAOYSA-N |
| MSDS | msds/36212_1_14472_80_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Magnesium dioxide | 14452-57-4 | 2A-9036198 |
| Potassium ferrocyanide trihyrate | 14459-95-1 | 2A-9036199 |
| Sodium tetrachloroplatinate(II) hydrate | 14460-25-4 | 2A-9036200 |
| Cristobalite | 14464-46-1 | 2A-9036204 |
| Talinolol | 38649-73-9 | 2A-9036210 |
| 3-Chlorocinnamic acid | 14473-90-6 | 2A-9036213 |
| Ferbam | 14484-64-1 | 2A-9036218 |
| 7-Methyltryptamine | 14490-05-2 | 2A-9036224 |
| Steapyrium chloride | 14492-68-3 | 2A-9036226 |
| Acetyltropylic chloride | 14510-37-3 | 2A-9036232 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA