
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14401-73-1 |
| Catalog No. | 2A-9036175 |
| Chinese Name | 3,5-二溴苯乙酮 |
| Synonyms | 1-(3,5-Dibromophenyl)ethanone |
| Molecular Formula | C8H6Br2O |
| Molecular Weight | 277.94 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 318.0±32.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| PubChem ID | 8700687 |
| SMILES | CC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H6Br2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3 |
| InChI Key | NHFJDRRYVMJBRJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl 4,4'-oxydibenzoate | 14387-30-5 | 2A-9036164 |
| 2-Chloro-6-methylpyrimidin-4-ylamine | 14394-60-6 | 2A-9036168 |
| 1,4-Dibromo-2,3-butanediol | 14396-65-7 | 2A-9036171 |
| 4-Chlorobenzene-1-carboximidamide hydrochloride | 14401-51-5 | 2A-9036173 |
| 3',5'-Dichloroacetophenone | 14401-72-0 | 2A-9036174 |
| EDTA magnesium disodium | 14402-88-1 | 2A-9036176 |
| Syringaldazine | 14414-32-5 | 2A-9036181 |
| Basic Green 4 | 14426-28-9 | 2A-9036182 |
| Ethyl 2-(4-chlorophenoxy)acetate | 14426-42-7 | 2A-9036183 |
| D-(+)-Glucose monohydrate | 14431-43-7 | 2A-9036185 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA