
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14387-30-5 |
| Catalog No. | 2A-9036164 |
| Chinese Name | 4,4'-氧代双苯甲酸二甲酯 |
| Synonyms | 4,4'-oxydibenzoate; 4,4'-oxy-di-benzoic acid dimethyl ester; Einecs 238-358-7; 4,4'-Oxy-di-benzoesaeure-dimethylester |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.27900 |
| Purity | 98.00 |
| Density | 1.214g/cm3 |
| Boiling Point | 404ºC at 760mmHg |
| HTC | 2918990090 |
| PubChem ID | 3357382 |
| SMILES | COC(=O)c1ccc(Oc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C16H14O5/c1-19-15(17)11-3-7-13(8-4-11)21-14-9-5-12(6-10-14)16(18)20-2/h3-10H,1-2H3 |
| InChI Key | CGARGJZZBOHMIZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Croconic acid disodium salt | 14379-00-1 | 2A-9036156 |
| N-Dodecanoyl-L-serine | 14379-56-7 | 2A-9036159 |
| N-Dodecanoyl-L-phenlyalanine | 14379-64-7 | 2A-9036160 |
| Nortropine hydrochloride | 14383-51-8 | 2A-9036162 |
| N,N'-Dihydroxy-2,3-dimethyl-2,3-butanediamine | 14384-45-3 | 2A-9036163 |
| 2-Chloro-6-methylpyrimidin-4-ylamine | 14394-60-6 | 2A-9036168 |
| 1,4-Dibromo-2,3-butanediol | 14396-65-7 | 2A-9036171 |
| 4-Chlorobenzene-1-carboximidamide hydrochloride | 14401-51-5 | 2A-9036173 |
| 3',5'-Dichloroacetophenone | 14401-72-0 | 2A-9036174 |
| 3,5-Dibromoacetophenone | 14401-73-1 | 2A-9036175 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA