
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13286-59-4 |
| Catalog No. | 2A-9035475 |
| Chinese Name | (1S,2S)-1-氨基-2-茚满醇 |
| Synonyms | (1S,2s)-1-amino-2,3-dihydro-1H-inden-2-ol |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 |
| Purity | 97 |
| Density | 1.212g/cm3 |
| Boiling Point | 290ºC at 760 mmHg |
| Melting Point | 142-146 °C |
| Appearance | solid |
| HTC | 2922199090 |
| PubChem ID | 24884631 |
| MDL Number | MFCD08275383 |
| SMILES | N[C@@H]1[C@@H](O)Cc2ccccc12 |
| InChI | 1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9-/m0/s1 |
| InChI Key | LOPKSXMQWBYUOI-IUCAKERBSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352116 |
| MSDS | msds/35475_1_13286_59_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-4-Chloro-1,2-epoxybutane | 13067-79-3 | 2A-9035321 |
| (3S,6S)-3-(Hydroxymethyl)-6-methyl-2,5-piperazinedione | 13174-73-7 | 2A-9035402 |
| (R)-2-Amino-4-(benzyloxy)-4-oxobutanoic acid | 13188-89-1 | 2A-9035410 |
| 2-Amino-5,7-dimethoxy-1,2,4-triazolo[1,5-a]pyrimidine | 13223-43-3 | 2A-9035441 |
| (R)-(-)-2-Aminobutane | 13250-12-9 | 2A-9035454 |
| 1-Benzyl-4-(4-methylphenyl)tetrahydropyridine | 13314-67-5 | 2A-9035495 |
| 1-Benzyl-4-(4-methoxyphenyl)tetrahydropyridine | 13314-69-7 | 2A-9035496 |
| 5,7-Dichlorothiazolo[5,4-d]pyrimidine | 13479-88-4 | 2A-9035640 |
| N-Cbz-Hydroxy-L-proline | 13504-85-3 | 2A-9035652 |
| (R)-(-)-3-Hydroxybutyric acid sodium salt | 13613-65-5 | 2A-9035723 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA