
CAS Number13228-39-2
Synonyms1-Ethyl-2-phenylindol; 1-Ethyl-2-phenyl-1H-indole; 2-phenyl-1-ethylindole; 1-ethyl-2-phenyl-indole; EINECS 236-199-8; MFCD00031481; 1-Ethyl-2-phenylindole; ethyl-1 phenyl-2 indole; n-ethyl-2-phenylindole
Molecular FormulaC16H15N1
Molecular Weight221.3
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point390.6±11.0 °C at 760 mmHg
Melting Point85-86°C
AppearanceYellow crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13228-39-2 |
| Catalog No. | 2A-9035445 |
| Chinese Name | 1-乙基-2-苯吲哚 |
| Synonyms | 1-Ethyl-2-phenylindol; 1-Ethyl-2-phenyl-1H-indole; 2-phenyl-1-ethylindole; 1-ethyl-2-phenyl-indole; EINECS 236-199-8; MFCD00031481; 1-Ethyl-2-phenylindole; ethyl-1 phenyl-2 indole; n-ethyl-2-phenylindole |
| Molecular Formula | C16H15N1 |
| Molecular Weight | 221.3 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 390.6±11.0 °C at 760 mmHg |
| Melting Point | 85-86°C |
| Appearance | Yellow crystalline powder |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2933990090 |
| PubChem ID | 4751095 |
| MDL Number | MFCD00031481 |
| SMILES | CCn1c(-c2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
| InChI Key | RAKSXVONTIQCGY-UHFFFAOYSA-N |
| MSDS | msds/35445_1_13228_39_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(2-Chloroethyl)-2-methyl-5-nitro-1H-imidazole | 13182-81-5 | 2A-9035405 |
| 2,5-Dibromo-3-methylthiophene | 13191-36-1 | 2A-9035414 |
| 2,3-O-Isopropylidene-D-ribofuranose | 13199-25-2 | 2A-9035423 |
| 5-Amino-8-hydroxyquinoline | 13207-66-4 | 2A-9035426 |
| Methyl 1-methyl-4-oxopiperidine-3-carboxylate | 13221-89-1 | 2A-9035438 |
| 2,5-Diethylpyrazine | 13238-84-1 | 2A-9035448 |
| 2-Ethyl-3-hydroxy-6-methylpyridine hydrochloride | 13258-59-8 | 2A-9035461 |
| (2-Bromoethyl)oxirane | 13287-42-8 | 2A-9035476 |
| 2-Phenyl-2H-1,2,3-triazole-4-carboxylic acid | 13306-99-5 | 2A-9035490 |
| 5-Hydroxy-2-methylindole | 13314-85-7 | 2A-9035497 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA