
CAS Number13207-66-4
Synonyms8-hydroxy-5-aminoquinoline; 5-Amino-8-hydroxyquinoline; 5-Amino-quinolin-8-ol; 5-azanylquinolin-8-ol; 5-Amino-8-quinolinol; 5-Amino-chinolin-8-ol; 8-Quinolinol,5-amino; 5-amino-8-hydroxyquinoline dihydrocholride
Molecular FormulaC9H8N2O
Molecular Weight160.18
Purity98.00%
Density1.363g/cm3
Boiling Point408.3ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13207-66-4 |
| Catalog No. | 2A-9035426 |
| Chinese Name | 5-氨基-8-羟基喹啉 |
| Synonyms | 8-hydroxy-5-aminoquinoline; 5-Amino-8-hydroxyquinoline; 5-Amino-quinolin-8-ol; 5-azanylquinolin-8-ol; 5-Amino-8-quinolinol; 5-Amino-chinolin-8-ol; 8-Quinolinol,5-amino; 5-amino-8-hydroxyquinoline dihydrocholride |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 |
| Purity | 98.00 |
| Density | 1.363g/cm3 |
| Boiling Point | 408.3ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| Application | 5-Amino-8-hydroxyquinoline (5A8HQ) is a potential anticancer drug candidate with good proteasome inhibitory activity. |
| HTC | 2933499090 |
| PubChem ID | 5920476 |
| MDL Number | C9H8N2O |
| SMILES | Nc1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C9H8N2O/c10-7-3-4-8(12)9-6(7)2-1-5-11-9/h1-5,12H,10H2 |
| InChI Key | YDEUKNRKEYICTH-UHFFFAOYSA-N |
| MSDS | msds/35426_1_13207_66_4.pdf |
| Use of | 5-Amino-8-hydroxyquinoline (5A8HQ), a potential anticancer candidate, has promising proteasome inhibitory activity. Properties Biological Activity Chemical & Physical Properties Safety Info Synthetic Route |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,6-Dichloro-2-methyl-5-nitropyrimidine | 13162-43-1 | 2A-9035391 |
| (+/-)-cis-Bicyclo[3.2.0]hept-2-en-6-one | 13173-09-6 | 2A-9035401 |
| 1-(2-Chloroethyl)-2-methyl-5-nitro-1H-imidazole | 13182-81-5 | 2A-9035405 |
| 2,5-Dibromo-3-methylthiophene | 13191-36-1 | 2A-9035414 |
| 2,3-O-Isopropylidene-D-ribofuranose | 13199-25-2 | 2A-9035423 |
| Methyl 1-methyl-4-oxopiperidine-3-carboxylate | 13221-89-1 | 2A-9035438 |
| 1-Ethyl-2-phenylindole | 13228-39-2 | 2A-9035445 |
| 2,5-Diethylpyrazine | 13238-84-1 | 2A-9035448 |
| 2-Ethyl-3-hydroxy-6-methylpyridine hydrochloride | 13258-59-8 | 2A-9035461 |
| (2-Bromoethyl)oxirane | 13287-42-8 | 2A-9035476 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA