
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 9031-72-5 |
| Catalog No. | 2A-9034488 |
| Chinese Name | 乙醇脱氢酶 |
| Synonyms | N-(3-Methoxyphenyl)-3-(propionylamino)benzamide; MFCD00081305 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.336 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 448.1±30.0 °C at 760 mmHg |
| Storage Condition | 1. The freeze-dried powder should be sealed with a |
| Application | Alcohol dehydrogenase is a dimeric protein in the cytoplasm of cells. Alcohol dehydrogenase is the key enzyme for alcohol consumption in the body. It is highest expressed in the liver and participates |
| EINECS | 232-870-4 |
| PubChem ID | 87561872 |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C43H66N7O18P3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-31(51)26-34(53)72-25-24-45-33(52)22-23-46-41(56)38(55)43(2,3)28-65-71(62,63)68-70(60,61)64-27-32-37(67-69(57,58)59)36(54)42(66-32)50-30-49-35-39(44)47-29-48-40(35)50/h5-6,8-9,11-12,14-15,17-18,29-30,32,36-38,42,54-55H,4,7,10,13,16,19-28H2,1-3H3,(H,45,52)(H,46,56)(H,60,61)(H,62,63)(H2,44,47,48)(H2,57,58,59)/p-4 |
| InChI Key | SLYKKQSPRFJDAF-UHFFFAOYSA-J |
| Transport Info | Product name: Alcohol dehydrogenase derived from Saccharomyces cerevisiae |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| beta-(1,3)-D-Glucan | 9012-72-0 | 2A-9034477 |
| Chitosan | 9012-76-4 | 2A-9034478 |
| Poly(dimethylsiloxane) | 9016-00-6 | 2A-9034481 |
| Poly(titanium butoxide) | 9022-96-2 | 2A-9034485 |
| Lactase | 9031-11-2 | 2A-9034487 |
| Glucozyme | 9032-08-0 | 2A-9034489 |
| Methyl 2-hydroxyethyl cellulose | 9032-42-2 | 2A-9034490 |
| Vasopressin | 9034-50-8 | 2A-9034493 |
| Cellulose diacetate | 9035-69-2 | 2A-9034494 |
| Chymotrypsinogen | 9035-75-0 | 2A-9034495 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA