
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 9008-02-0 |
| Catalog No. | 2A-9034465 |
| Chinese Name | 血红蛋白 |
| Synonyms | MFCD00131282; Deoxyhemoglobins; Ferrohemoglobins; Hemoglobin human; Blood pigments |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.2307 |
| Purity | 15 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 400.9±45.0 °C at 760 mmHg |
| Appearance | lyophilized powder |
| Water Solubility | 0.6 M HCl: soluble20mg/mL | Soluble in water. |
| Storage Condition | 2. Storage It should be sealed in an ampoule fille |
| Application | Hemoglobin (hemoglobin) is an iron-containing protein in red blood cells that has oxygen-binding properties. Hemoglobin is composed of heme, which binds to oxygen. Hemoglobin also transports other gas |
| MDL Number | MFCD00131282 |
| SMILES | Cc1ccc2c(=O)cc(-c3ccco3)[nH]c2n1 |
| InChI Key | INGWEZCOABYORO-UHFFFAOYSA-N |
| NACRES Code | NA.61 |
| eCl@ss | 42030116 |
| UNSPSC | 12352202 |
| MSDS | msds/34465_1_9008_02_0.pdf |
| Transport Info | Product name: Hemoglobin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Chlorinated rubber | 9006-03-5 | 2A-9034454 |
| Ovalbumin | 9006-59-1 | 2A-0200251 |
| Collagens polypeptide | 9007-34-5 | 2A-9034460 |
| Edestin | 9007-57-2 | 2A-9034462 |
| Glucagon | 9007-92-5 | 2A-9034464 |
| Nucleic acids | 9008-72-4 | 2A-9034467 |
| Zein | 9010-66-6 | 2A-9034469 |
| Polychloroprene | 9010-98-4 | 2A-9034470 |
| Poly(methyl vinyl ether-alt-maleic anhydride) | 9011-16-9 | 2A-9034473 |
| Cholera toxin | 9012-63-9 | 2A-9034476 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA