CAS Number7461-60-1
Synonyms(2E)-3-(2,3-Dimethoxyphenyl)acrylic acid; 2,3-dimethoxy trans-cinnamic acid; 3-(2,3-Dihydro-benzo[b]furan-5-yl)acrylic acid; 2,3-Dimethoxy cinnamic acid; 3-(2,3-dihydro-1-benzofuran-5-yl)-2-propenoic acid; 2,3-Dimethoxy-zimtsaeure; 2,3-Dimethoxycinnamic acid; (2E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid; EINECS 231-249-5; (E)-3-(2,3-Dimethoxyphenyl)acrylic acid; (E)-3-(2,3-dimethoxyphenyl)propenoic acid; 2,3-DICHLORO-6-FLUOROBENZYL BROMIDE; 2,3-DICHLORO-6-FLUOROBENZYL ALCOHOL; (E)-3-(2,3-Dihydrobenzo[b]furan-5-yl)acrylic acid; 3-(2,3-dimethoxyphenyl)prop-2-enoic acid; (E)-3-(2,3-dihydrobenzofuran-5-yl)acrylic acid; MFCD00004376
Molecular FormulaC11H12O4
Molecular Weight208.211
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point351.6±27.0 °C at 760 mmHg
Melting Point182-184 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7461-60-1 |
| Catalog No. | 2A-9033712 |
| Chinese Name | 2,3－二甲氧基肉桂酸 |
| Synonyms | (2E)-3-(2,3-Dimethoxyphenyl)acrylic acid; 2,3-dimethoxy trans-cinnamic acid; 3-(2,3-Dihydro-benzo[b]furan-5-yl)acrylic acid; 2,3-Dimethoxy cinnamic acid; 3-(2,3-dihydro-1-benzofuran-5-yl)-2-propenoic acid; 2,3-Dimethoxy-zimtsaeure; 2,3-Dimethoxycinnamic acid; (2E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid; EINECS 231-249-5; (E)-3-(2,3-Dimethoxyphenyl)acrylic acid; (E)-3-(2,3-dimethoxyphenyl)propenoic acid; 2,3-DICHLORO-6-FLUOROBENZYL BROMIDE; 2,3-DICHLORO-6-FLUOROBENZYL ALCOHOL; (E)-3-(2,3-Dihydrobenzo[b]furan-5-yl)acrylic acid; 3-(2,3-dimethoxyphenyl)prop-2-enoic acid; (E)-3-(2,3-dihydrobenzofuran-5-yl)acrylic acid; MFCD00004376 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 351.6±27.0 °C at 760 mmHg |
| Melting Point | 182-184 °C(lit.) |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918990090 |
| SMILES | COc1cccc(C=CC(=O)O)c1OC |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-4-8(11(9)15-2)6-7-10(12)13/h3-7H,1-2H3,(H,12,13)/b7-6+ |
| InChI Key | QAXPUWGAGVERSJ-VOTSOKGWSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium acrylate | 7446-81-3 | 2A-9033699 |
| Cupric chloride | 7447-39-4 | 2A-9033700 |
| Mordant Violet 1 | 7452-51-9 | 2A-9033704 |
| Ethyl 2-methylbutyrate | 7452-79-1 | 2A-9033705 |
| Rubiadin 1-methyl ether | 7460-43-7 | 2A-9033709 |
| 3'-Acetamidoacetophenone | 7463-31-2 | 2A-9033714 |
| 2-(4-Nitrophenyl)butyric acid | 7463-53-8 | 2A-9033716 |
| 1,7-Dimethyl-3-isobutylxanthine | 7464-84-8 | 2A-9033719 |
| 4-Morpholinobenzoic acid | 7470-38-4 | 2A-9033722 |
| 2-Hydroxy-2-methylpropiophenone | 7473-98-5 | 2A-9033726 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS