
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6342-64-9 |
| Catalog No. | 2A-9032777 |
| Chinese Name | 5-氯-2-甲氧基苯乙酮 |
| Synonyms | MFCD00174339; 1-(5-Chloro-2-methoxyphenyl)ethanone |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.620 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 278.1±25.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| SMILES | COc1ccc(Cl)cc1C(C)=O |
| InChI | InChI=1S/C9H9ClO2/c1-6(11)8-5-7(10)3-4-9(8)12-2/h3-5H,1-2H3 |
| InChI Key | QPIUQLBBCQTWMJ-UHFFFAOYSA-N |
| MSDS | msds/32777_1_6342_64_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Cyano-N-methylacetamide | 6330-25-2 | 2A-9032762 |
| 3,4-Dichloroaniline-6-sulfonic acid | 6331-96-0 | 2A-9032764 |
| N,N,N',N'-Tetrakis(2-hydroxyethyl)adipamide | 6334-25-4 | 2A-9032768 |
| 7-(Acetylamino)-4-hydroxy-2-naphthalenesulfonic acid | 6334-97-0 | 2A-9032769 |
| D-Histidine hydrochloride monohydrate | 6341-24-8 | 2A-9032773 |
| 4,5-Dimethoxy-1-indanone | 6342-80-9 | 2A-9032779 |
| N-Benzylglycine ethyl ester hydrochloride | 6344-42-9 | 2A-9032780 |
| 5-(Acetylamino)isophthalic acid | 6344-50-9 | 2A-9032781 |
| 4,4-Diethoxybutylamine | 6346-09-4 | 2A-9032785 |
| 4,6-Dihydroxynaphthalene-2-sulphonic acid | 6357-93-3 | 2A-9032786 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA