
CAS Number6331-96-0
SynonymsMFCD00036096; 3,4-Dichloroaniline-6-sulfonic acid; 2-Amino-4,5-dichlorobenzenesulfonic acid; ZR CG DG FSWQ
Molecular FormulaC6H5Cl2NO3S
Molecular Weight242.080
Purity98.00%
Density1.7±0.1 g/cm3
Boiling Point270 °C(lit.)
Melting Point8-10 °C(lit.)
AppearanceWhite to light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6331-96-0 |
| Catalog No. | 2A-9032764 |
| Chinese Name | 3,4-二氯苯胺-6-磺酸 |
| Synonyms | MFCD00036096; 3,4-Dichloroaniline-6-sulfonic acid; 2-Amino-4,5-dichlorobenzenesulfonic acid; ZR CG DG FSWQ |
| Molecular Formula | C6H5Cl2NO3S |
| Molecular Weight | 242.080 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 270 °C(lit.) |
| Melting Point | 8-10 °C(lit.) |
| Appearance | White to light yellow powder |
| Water Solubility | Soluble in: dimethylformamide |
| Storage Condition | room temperature |
| HTC | 2921420090 |
| SMILES | Nc1cc(Cl)c(Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C6H5Cl2NO3S/c7-3-1-5(9)6(2-4(3)8)13(10,11)12/h1-2H,9H2,(H,10,11,12) |
| InChI Key | AKLDPNVZTZIVFA-UHFFFAOYSA-N |
| MSDS | msds/32764_1_6331_96_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Bromoisatin | 6326-79-0 | 2A-9032757 |
| 3-(Benzyloxy)propionitrile | 6328-48-9 | 2A-9032758 |
| 6-Methyl-2-(methylthio)pyrimidin-4-ol | 6328-58-1 | 2A-9032759 |
| Ethyl 2-chloroethylcarbamate | 6329-26-6 | 2A-9032760 |
| 2-Cyano-N-methylacetamide | 6330-25-2 | 2A-9032762 |
| N,N,N',N'-Tetrakis(2-hydroxyethyl)adipamide | 6334-25-4 | 2A-9032768 |
| 7-(Acetylamino)-4-hydroxy-2-naphthalenesulfonic acid | 6334-97-0 | 2A-9032769 |
| D-Histidine hydrochloride monohydrate | 6341-24-8 | 2A-9032773 |
| 5-Chloro-2-methoxyacetophenone | 6342-64-9 | 2A-9032777 |
| 4,5-Dimethoxy-1-indanone | 6342-80-9 | 2A-9032779 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA