CAS Number6307-83-1
SynonymsWNR CE EVQ; 3-nitro-5-bromobenzoic acid; 3-Bromo-5-nitrobenzoic acid; MFCD00100098; 5-bromo-3-nitrobenzoic acid; Benzoic acid,3-bromo-5-nitro; 3-Brom-5-nitro-benzoesaeure; 3-bromo-5-nitro benzoic acid
Molecular FormulaC7H3O4N1Cl1F1
Molecular Weight246.015
Purity98.00%
Density1.9±0.1 g/cm3
Boiling Point376.8±32.0 °C at 760 mmHg
Melting Point159-161°C
AppearanceWhite to slightly yellow crystalline needle-like
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6307-83-1 |
| Catalog No. | 2A-9032720 |
| Chinese Name | 3-硝基-5-溴苯甲酸 |
| Synonyms | WNR CE EVQ; 3-nitro-5-bromobenzoic acid; 3-Bromo-5-nitrobenzoic acid; MFCD00100098; 5-bromo-3-nitrobenzoic acid; Benzoic acid,3-bromo-5-nitro; 3-Brom-5-nitro-benzoesaeure; 3-bromo-5-nitro benzoic acid |
| Molecular Formula | C7H3O4N1Cl1F1 |
| Molecular Weight | 246.015 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 376.8±32.0 °C at 760 mmHg |
| Melting Point | 159-161°C |
| Appearance | White to slightly yellow crystalline needle-like |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2916399090 |
| MDL Number | MFCD12173034 |
| SMILES | Fc1c(cc(cc1C(=O)O)Cl)[N+](=O)[O-] |
| InChI | 1S/C7H3ClFNO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| InChI Key | FFLWLOLRLIMBGA-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/32720_1_6307_83_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Bromo-5-nitrobenzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-4'-hydroxyacetophenone | 6305-04-0 | 2A-9032710 |
| 1,2-Dichloro-4,5-dinitrobenzene | 6306-39-4 | 2A-9032713 |
| 2-Phthalimido-3-methylbutanoic acid | 6306-54-3 | 2A-9032715 |
| N-(1H-Benzimidazol-2-yl)carbamic acid ethyl ester | 6306-71-4 | 2A-9032717 |
| Methyl 2-chloro-5-nitrobenzoate | 6307-82-0 | 2A-9032719 |
| Methyl 3-bromo-5-nitrobenzoate | 6307-87-5 | 2A-9032721 |
| 1-(2-Thienyl)ethylamine | 6309-16-6 | 2A-9032722 |
| 2-tert-Butylaniline | 6310-21-0 | 2A-9032725 |
| 4-Amino-3-bromobenzoic acid | 6311-37-1 | 2A-9032727 |
| 2,5-Dimethoxy-4-nitroaniline | 6313-37-7 | 2A-9032731 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS