
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6305-04-0 |
| Catalog No. | 2A-9032710 |
| Chinese Name | 2-氯-4'-羟基苯乙酮 |
| Synonyms | 2-Chloro-1-(4-hydroxyphenyl)ethanone; EINECS 228-613-0 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.597 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 337.1±17.0 °C at 760 mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD00229893 |
| SMILES | O=C(CCl)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H7ClO2/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,10H,5H2 |
| InChI Key | PPPIAEPDQPCIIM-UHFFFAOYSA-N |
| MSDS | msds/32710_1_6305_04_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (1,3-Benzothiazol-2-ylthio)acetic acid | 6295-57-4 | 2A-9032693 |
| Diethyl aminomethylenemalonate | 6296-99-7 | 2A-9032695 |
| 2,7-Dichloro-9-fluorenone | 6297-11-6 | 2A-9032696 |
| 4-Amino-3-methoxyazobene-3'-sulfonic acid sodium salt | 6300-07-8 | 2A-9032703 |
| 4-Phenoxybutanoic acid | 6303-58-8 | 2A-9032706 |
| 1,2-Dichloro-4,5-dinitrobenzene | 6306-39-4 | 2A-9032713 |
| 2-Phthalimido-3-methylbutanoic acid | 6306-54-3 | 2A-9032715 |
| N-(1H-Benzimidazol-2-yl)carbamic acid ethyl ester | 6306-71-4 | 2A-9032717 |
| Methyl 2-chloro-5-nitrobenzoate | 6307-82-0 | 2A-9032719 |
| 3-Bromo-5-nitrobenzoic acid | 6307-83-1 | 2A-9032720 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA