
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6301-60-6 |
| Catalog No. | 2A-9032704 |
| Chinese Name | 4-碘邻苯二甲酸 |
| Synonyms | 4-iodo-phthalic acid; 4-Jod-phthalsaeure |
| Molecular Formula | C8H5O4I1 |
| Molecular Weight | 292.03 |
| Purity | 98.00 |
| Density | 2.138g/cm3 |
| Boiling Point | 431.1ºC at 760 mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2917399090 |
| MDL Number | MFCD00673159 |
| SMILES | O=C(O)c1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C8H5IO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChI Key | NVBFLFQAJXJZIE-UHFFFAOYSA-N |
| MSDS | msds/32704_1_6301_60_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| Ethyl 2-(triphenylphosphoranylidene)propionate | 5717-37-3 | 2A-9032090 |
| Triprolidine hydrochloride | 6138-79-0 | 2A-9032507 |
| (+/-)-Pseudopelletierine oxime | 6164-67-6 | 2A-9032549 |
| Propyltriphenylphosphonium bromide | 6228-47-3 | 2A-9032606 |
| (Triphenylsilyl)acetylene | 6229-00-1 | 2A-9032608 |
| Triphenylphosphine hydrobromide | 6399-81-1 | 2A-9032854 |
| 4'-Demethylepipodophyllotoxin | 6559-91-7 | 2A-9032979 |
| 3,4-Diiodopyrazole | 6645-70-1 | 2A-9033068 |
| Dichloromethylenetriphenylphosphorane | 6779-08-4 | 2A-9033133 |
| 4-Hydroxy-3,5-diiodopyridine | 7153-08-4 | 2A-9033447 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA