
CAS Number2887-61-8
Synonyms1-(2-hydroxy-phenyl)-butan-1-one; 2'-HYDROXY-6'-METHOXYCHALCONE 0.99; 2-Hydroxybutyrophenone; 2'-hydroxybutyrophenone; 1-(2-Hydroxy-phenyl)-butan-1-on; 1-(2-hydroxyphenyl)butan-1-one; EINECS 220-749-9; Butyrophenone,2'-hydroxy; 1-Butanone,1-(2-hydroxyphenyl); MFCD00020041; 1-(2-Hydroxyphenyl)-1-butanone
Molecular FormulaC10H12O2
Molecular Weight164.2
Purity98%
Density1.1±0.1 g/cm3
Boiling Point253.7±13.0 °C at 760 mmHg
AppearanceColorless to light yellow
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2887-61-8 |
| Catalog No. | 2A-9003270 |
| Chinese Name | 2'-羟基苯丁酮 |
| Synonyms | 1-(2-hydroxy-phenyl)-butan-1-one; 2'-HYDROXY-6'-METHOXYCHALCONE 0.99; 2-Hydroxybutyrophenone; 2'-hydroxybutyrophenone; 1-(2-Hydroxy-phenyl)-butan-1-on; 1-(2-hydroxyphenyl)butan-1-one; EINECS 220-749-9; Butyrophenone,2'-hydroxy; 1-Butanone,1-(2-hydroxyphenyl); MFCD00020041; 1-(2-Hydroxyphenyl)-1-butanone |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 253.7±13.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow |
| Storage Condition | Room Temperature |
| HTC | 2914501900 |
| MDL Number | MFCD00020041 |
| SMILES | CCCC(=O)c1ccccc1O |
| InChI | InChI=1S/C10H12O2/c1-2-5-9(11)8-6-3-4-7-10(8)12/h3-4,6-7,12H,2,5H2,1H3 |
| InChI Key | GUDQIKIAWOAOFP-UHFFFAOYSA-N |
| MSDS | msds/3270_1_2887_61_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2914501900 other ketone-phenols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxy-5-thioureidobenzoic acid | 728918-63-6 | 2A-9003256 |
| 2'-Hydroxyacetophenone | 118-93-4 | 2A-9003265 |
| 2-Hydroxyacetophenone | 582-24-1 | 2A-9003266 |
| 2-Hydroxybenzophenone | 117-99-7 | 2A-9003268 |
| 2-Hydroxybenzyl alcohol | 90-01-7 | 2A-9003269 |
| 2-Hydroxycinamic acid | 614-60-8 | 2A-9003272 |
| 2-Hydroxyethyl 4-nitrophenyl sulfide | 13287-76-8 | 2A-9003273 |
| 2-Hydroxyethyl benzyl sulfide | 3878-41-9 | 2A-9003274 |
| 2-Hydroxyimino-1-((4-methylphenyl)sulfonyl)eth-2-ylamine | 72660-98-1 | 2A-9003277 |
| 2-Hydroxyisonicotinonitrile | 95891-29-5 | 2A-9003278 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA