
CAS Number6175-49-1
SynonymsEINECS 228-222-5; DECYL METHYL KETONE; MFCD00015064; dodecane-2-one; N-DECYL METHYL KETONE; 2-Dodecanone; METHYL DECYL KETONE; 2-Dodecanon; dodecan-2-one; 2-dodecanal
Molecular FormulaC18H27ClO2
Molecular Weight310.868
Purity98.00%
Density0.8±0.1 g/cm3
Boiling Point247.8±3.0 °C at 760 mmHg
Melting Point17-20 °C
AppearanceColorless liquid with unique odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6175-49-1 |
| Catalog No. | 2A-9032561 |
| Chinese Name | 2-十二酮 |
| Synonyms | EINECS 228-222-5; DECYL METHYL KETONE; MFCD00015064; dodecane-2-one; N-DECYL METHYL KETONE; 2-Dodecanone; METHYL DECYL KETONE; 2-Dodecanon; dodecan-2-one; 2-dodecanal |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.868 |
| Purity | 98.00 |
| Density | 0.8±0.1 g/cm3 |
| Boiling Point | 247.8±3.0 °C at 760 mmHg |
| Melting Point | 17-20 °C |
| Appearance | Colorless liquid with unique odor |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2914190090 |
| MDL Number | MFCD01098798 |
| SMILES | CCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C12H24O/c1-3-4-5-6-7-8-9-10-11-12(2)13/h3-11H2,1-2H3 |
| InChI Key | LSKONYYRONEBKA-UHFFFAOYSA-N |
| MSDS | msds/32561_1_6175_49_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tris(2-methylphenyl)phosphine | 6163-58-2 | 2A-9032548 |
| Propargyl benzenesulfonate | 6165-75-9 | 2A-9032554 |
| DL-Alaninol | 6168-72-5 | 2A-9032556 |
| Chloropyramine hydrochloride | 6170-42-9 | 2A-9032559 |
| 2,2-Diethoxyacetophenone | 6175-45-7 | 2A-9032560 |
| Glycidyl 4-nonylphenyl ether | 6178-32-1 | 2A-9032562 |
| Ethyl 3,4,5-trimethoxybenzoate | 6178-44-5 | 2A-9032563 |
| 3-Ethoxyacryloyl chloride | 6191-99-7 | 2A-9032570 |
| 3-Ethoxyacrylic acid | 6192-01-4 | 2A-9032572 |
| Cyclopropyl 2-thienyl ketone | 6193-47-1 | 2A-9032574 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA