CAS Number6153-44-2
Synonyms4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, methyl ester; Methyl 2,6-dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylate; methyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate; EINECS 228-171-9; methyl 2,4-dioxo-1H-pyrimidine-6-carboxylate; MFCD00010564
Molecular FormulaC6H6N2O4
Molecular Weight170.123
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point299.73°C (rough estimate)
Melting Point244ºC
AppearanceYellow to light brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6153-44-2 |
| Catalog No. | 2A-9032534 |
| Chinese Name | 乳清酸甲酯 |
| Synonyms | 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, methyl ester; Methyl 2,6-dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylate; methyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate; EINECS 228-171-9; methyl 2,4-dioxo-1H-pyrimidine-6-carboxylate; MFCD00010564 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.123 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 299.73°C (rough estimate) |
| Melting Point | 244ºC |
| Appearance | Yellow to light brown crystalline powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2933599090 |
| SMILES | COC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H6N2O4/c1-12-5(10)3-2-4(9)8-6(11)7-3/h2H,1H3,(H2,7,8,9,11) |
| InChI Key | UUTDWTOZAWFKFW-UHFFFAOYSA-N |
| MSDS | msds/32534_1_6153_44_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl potassium malonate | 6148-64-7 | 2A-9032521 |
| Sodium mesitylenesulfonate | 6148-75-0 | 2A-9032522 |
| Sodium diphenylamine-4-sulfonate | 6152-67-6 | 2A-9032528 |
| (Z)-3-Methylpent-2-en-4-yn-1-ol | 6153-05-5 | 2A-9032529 |
| Mebhydrolin napadisylate | 6153-33-9 | 2A-9032532 |
| Oxalic acid dihydrate | 6153-56-6 | 2A-0202062 |
| L-Rhamnose monohydrate | 6155-35-7 | 2A-9032538 |
| Manganese(II) acetate tetrahydrate | 6156-78-1 | 2A-9032540 |
| Vasicine | 6159-55-3 | 2A-9032542 |
| 2-Methoxy-6-methylbenzoic acid | 6161-65-5 | 2A-9032547 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS