
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5981-09-9 |
| Catalog No. | 2A-9032370 |
| Chinese Name | 三(4-氨基苯基)胺 |
| Synonyms | 4-N,4-N-bis(4-aminophenyl)benzene-1,4-diamine |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 |
| Purity | 98.00 |
| Density | 1.276g/cm3 |
| Boiling Point | 571.3ºC at 760 mmHg |
| Melting Point | 230ºC |
| Appearance | Yellow crystalline solid |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2921590090 |
| MDL Number | MFCD00778301 |
| SMILES | Nc1ccc(N(c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C18H18N4/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H,19-21H2 |
| InChI Key | SNLFYGIUTYKKOE-UHFFFAOYSA-N |
| MSDS | msds/32370_1_5981_09_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards Tris(4-aminophenyl)amine Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-1-naphthol hydrochloride | 5959-56-8 | 2A-9032351 |
| 2-Acetylphenanthrene | 5960-69-0 | 2A-9032353 |
| N-Methyl-4-anisidine | 5961-59-1 | 2A-9032354 |
| Manganese(III) citrate | 5968-88-7 | 2A-9032359 |
| Acetoacetamide | 5977-14-0 | 2A-9032366 |
| Isonipecotic acid hydrochloride | 5984-56-5 | 2A-9032372 |
| Patchouli alcohol | 5986-55-0 | 2A-9032374 |
| Oxybuprocaine hydrochloride | 5987-82-6 | 2A-9032376 |
| L-Dihydroorotic acid | 5988-19-2 | 2A-9032377 |
| Zinc citrate dihydrate | 5990-32-9 | 2A-0202016 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA