
CAS Number735-06-8
Synonyms(2-fluorophenyl)-[2-(methylamino)-5-nitrophenyl]methanone; EINECS 211-998-4; MFCD06658167; (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
Molecular FormulaC14H12N2O3
Molecular Weight256.263
Purity98%
Density1.4±0.1 g/cm3
Boiling Point478.8±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 735-06-8 |
| Catalog No. | 2A-9003094 |
| Chinese Name | 2-甲氨基-5-硝基-2'-氟二苯甲酮 |
| Synonyms | (2-fluorophenyl)-[2-(methylamino)-5-nitrophenyl]methanone; EINECS 211-998-4; MFCD06658167; (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.263 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 478.8±45.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922399090 |
| MDL Number | MFCD00007258 |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1F |
| InChI | InChI=1S/C14H11FN2O3/c1-16-13-7-6-9(17(19)20)8-11(13)14(18)10-4-2-3-5-12(10)15/h2-8,16H,1H3 |
| InChI Key | GVXPKRIRHDRCGY-UHFFFAOYSA-N |
| MSDS | msds/3094_1_735_06_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Ethylanisate | 7335-26-4 | 2A-9003086 |
| 2-Ethylbutyl methacrylate | 5138-86-3 | 2A-9003087 |
| 2-Ethylhexyl 4-dimethylaminobenzoate | 21245-02-3 | 2A-9003088 |
| 2-Ethylphenylhydrazine hydrochloride | 58711-02-7 | 2A-9003089 |
| 2-Fluoro-1,3-dimethylbenzene | 443-88-9 | 2A-9003093 |
| 2-Fluoro-3-methylbenzoic acid | 315-31-1 | 2A-9003099 |
| 2-Fluoro-3-methylbenzonitrile | 2A-103100 | 2A-9003100 |
| 2-Fluoro-4-bromobenzyl bromide | 76283-09-5 | 2A-9003106 |
| 2'-Fluoro-4'-hydroxyacetophenone | 98619-07-9 | 2A-9003107 |
| 2-Fluoro-4-hydroxybenzonitrile | 82380-18-5 | 2A-9003109 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA