CAS Number7335-26-4
Synonyms2-ETHYLANISATE; Ethylo-ethoxybenzoate; Ethyl-o-anisat; ethyl o-methoxybenzoate; RARECHEM AL BI 0022; o-Anisic acid ethyl; o-Anisic acid,ethyl ester; Ethyl 2-Methoxybenzonate; MFCD00015148; ETHYL O-ANISATE; ethyl methoxybenzoate; ETHYL 2-METHOXYBENZOATE; 2-methoxy-benzoic acid ethyl ester; EINECS 230-843-1
Molecular FormulaC10H12O3
Molecular Weight180.20000
Purity98%
Density1.112
Boiling Point127-128°C 11mm
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7335-26-4 |
| Catalog No. | 2A-9003086 |
| Chinese Name | 邻甲氧基苯甲酸乙酯 |
| Synonyms | 2-ETHYLANISATE; Ethylo-ethoxybenzoate; Ethyl-o-anisat; ethyl o-methoxybenzoate; RARECHEM AL BI 0022; o-Anisic acid ethyl; o-Anisic acid,ethyl ester; Ethyl 2-Methoxybenzonate; MFCD00015148; ETHYL O-ANISATE; ethyl methoxybenzoate; ETHYL 2-METHOXYBENZOATE; 2-methoxy-benzoic acid ethyl ester; EINECS 230-843-1 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20000 |
| Purity | 98 |
| Density | 1.112 |
| Boiling Point | 127-128°C 11mm |
| Storage Condition | Store sealed in a cool, dry environment. |
| HTC | 2918990090 |
| SMILES | CCOC(=O)c1ccccc1OC |
| InChI | InChI=1S/C10H12O3/c1-3-13-10(11)8-6-4-5-7-9(8)12-2/h4-7H,3H2,1-2H3 |
| InChI Key | FNODWEPAWIJGPM-UHFFFAOYSA-N |
| MSDS | msds/3086_1_7335_26_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Ethoxyethyl cyanoacetate | 32804-77-6 | 2A-9003075 |
| 2-Ethoxynaphthalene | 93-18-5 | 2A-9003076 |
| 2-Ethoxypropene | 926-66-9 | 2A-9003079 |
| 2-Ethyl-1,3-cyclopentanedione | 823-36-9 | 2A-9003082 |
| 2-Ethyl-2-adamantanol | 14648-57-8 | 2A-9003083 |
| 2-Ethylbutyl methacrylate | 5138-86-3 | 2A-9003087 |
| 2-Ethylhexyl 4-dimethylaminobenzoate | 21245-02-3 | 2A-9003088 |
| 2-Ethylphenylhydrazine hydrochloride | 58711-02-7 | 2A-9003089 |
| 2-Fluoro-1,3-dimethylbenzene | 443-88-9 | 2A-9003093 |
| 2'-Fluoro-2-methylamino-5-nitrobenzophenone | 735-06-8 | 2A-9003094 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS