
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4265-27-4 |
| Catalog No. | 2A-9030713 |
| Chinese Name | 2-丁基苯并呋喃 |
| Synonyms | 2-Butyl-benzofuran; EINECS 224-250-7; 2-Butyl-1-benzofuran; 2-n-Butylbenzo[b]Furan; MFCD00005851 |
| Molecular Formula | C12H14O1 |
| Molecular Weight | 174.24 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 248.1±9.0 °C at 760 mmHg |
| Appearance | light yellow |
| Storage Condition | - Avoid light, keep in a ventilated and dry place, |
| HTC | 2932999099 |
| MDL Number | MFCD00005851 |
| SMILES | CCCCc1cc2ccccc2o1 |
| InChI | InChI=1S/C12H14O/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h4-6,8-9H,2-3,7H2,1H3 |
| InChI Key | OVJKFJDEVKABNF-UHFFFAOYSA-N |
| MSDS | msds/30713_1_4265_27_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Vinylpyrazine | 4177-16-6 | 2A-9030631 |
| 2-Allyloxytetrahydropyran | 4203-49-0 | 2A-9030656 |
| 1-Benzylimidazole | 4238-71-5 | 2A-9030687 |
| 3-Acetyl-2-ethylbenzofuran | 4265-18-3 | 2A-9030711 |
| 2-Methylbenzofuran | 4265-25-2 | 2A-9030712 |
| Methyl 1H-Pyrrole-1-carboxylate | 4277-63-8 | 2A-9030724 |
| Dimethyl furan-2,5-dicarboxylate | 4282-32-0 | 2A-9030726 |
| 2-(4-Nitrophenyl)pyridine | 4282-47-7 | 2A-9030729 |
| 4-(3-Nitrophenyl)pyridine | 4282-48-8 | 2A-9030730 |
| 4-Chloro-6-methoxyquinoline | 4295-04-9 | 2A-9030738 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA