
CAS Number2486-66-0
Synonyms2-Ethoxy-4-nitrobenzoic acid; MFCD02683865; Benzoic acid,2-ethoxy-4-nitro; 2-Aethoxy-4-nitro-benzoesaeure; 2-ethoxy-4-nitro-benzoic Acid
Molecular FormulaC9H9NO5
Molecular Weight225.15
Purity97%
Density1.368g/cm3
Boiling Point395.9ºC at 760 mmHg
Melting Point148-151 °C(lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2486-66-0 |
| Catalog No. | 2A-9003069 |
| Chinese Name | 2-乙氧基-4-硝基苯甲酸 |
| Synonyms | 2-Ethoxy-4-nitrobenzoic acid; MFCD02683865; Benzoic acid,2-ethoxy-4-nitro; 2-Aethoxy-4-nitro-benzoesaeure; 2-ethoxy-4-nitro-benzoic Acid |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 225.15 |
| Purity | 97 |
| Density | 1.368g/cm3 |
| Boiling Point | 395.9ºC at 760 mmHg |
| Melting Point | 148-151 °C(lit.) |
| Appearance | solid |
| Storage Condition | Keep container tightly closed and stored in a cool |
| HTC | 2918990090 |
| PubChem ID | 329830322 |
| MDL Number | MFCD07782180 |
| SMILES | O=C(C1=C(CC(O)=O)C=C([N+]([O-])=O)C=C1)O |
| InChI | 1S/C9H7NO6/c11-8(12)4-5-3-6(10(15)16)1-2-7(5)9(13)14/h1-3H,4H2,(H,11,12)(H,13,14) |
| InChI Key | CKXXWBQEZGLFMV-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/3069_1_2486_66_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Deoxy-D-glucose | 154-17-6 | 2A-9003057 |
| 2-Deoxy-D-ribose | 533-67-5 | 2A-9003058 |
| 2-Deoxy-L-ribose | 18546-37-7 | 2A-9003062 |
| 2-Diacetylamino-3,5-dibromobenzyl bromide | 2A-103064 | 2A-9003064 |
| 2-Diethylaminoethanethiol | 100-38-9 | 2A-9003065 |
| 2-Ethoxy-6-(2,2,2-trifluoroethoxy)benzonitrile | 175204-04-3 | 2A-9003071 |
| 2'-Ethoxyacetophenone | 14869-39-7 | 2A-9003072 |
| 2-Ethoxybenzamide | 938-73-8 | 2A-9003073 |
| 2-Ethoxybenzonitrile | 6609-57-0 | 2A-9003074 |
| 2-Ethoxyethyl cyanoacetate | 32804-77-6 | 2A-9003075 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA