CAS Number4151-33-1
SynonymsPotassium pyruvate; PYRUVIC ACID POTASSIUM SALT; Potassium 2-oxopropanoate; Propanoic acid, 2-oxo-, potassium salt (1:1); 2-oxo-propanoicacipotassiumsalt; Kaliumpyruvat; Einecs 223-978-2; 2-Oxopropionic acid potassium salt; Propanoic acid, 2-oxo-, potassium salt; MFCD00053313; EGHYT PYRUVATE; Propanoic acid,2-oxo-,potassium salt
Molecular FormulaC3H3KO3
Molecular Weight209.11
Purity≥97 (CP)%
Density1.83 g/mL at 25 °C
Boiling Point165ºC at 760 mmHg
Appearancesolid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4151-33-1 |
| Catalog No. | 2A-9030604 |
| Chinese Name | 丙酮酸钾 |
| Synonyms | Potassium pyruvate; PYRUVIC ACID POTASSIUM SALT; Potassium 2-oxopropanoate; Propanoic acid, 2-oxo-, potassium salt (1:1); 2-oxo-propanoicacipotassiumsalt; Kaliumpyruvat; Einecs 223-978-2; 2-Oxopropionic acid potassium salt; Propanoic acid, 2-oxo-, potassium salt; MFCD00053313; EGHYT PYRUVATE; Propanoic acid,2-oxo-,potassium salt |
| Molecular Formula | C3H3KO3 |
| Molecular Weight | 209.11 |
| Purity | ≥97 (CP) |
| Density | 1.83 g/mL at 25 °C |
| Boiling Point | 165ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | Store at room temperature, away from light, in a v |
| Packaging | II |
| HTC | 2918300090 |
| SMILES | [13CH2]=[13C]([13C](O)=O)OP(O)(O[K])=O |
| InChI | InChI=1S/C3H4O3.K/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
| InChI Key | JKVUQLWTIZFTMF-UHFFFAOYSA-M |
| UNSPSC | 12352106 |
| Hazard Symbols | 8 |
| MSDS | msds/30604_1_4151_33_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4,6-Trichlorobenzoyl chloride | 4136-95-2 | 2A-9030595 |
| Methyl 3-aminopropanoate | 4138-35-6 | 2A-9030598 |
| cis-2-Phenyl-1,3-dioxan-5-ol | 4141-19-9 | 2A-9030600 |
| N-tert-Butylmaleimide | 4144-22-3 | 2A-9030601 |
| Framycetin sulphate | 4146-30-9 | 2A-9030602 |
| Tris(4-isocyanatophenyl) thiophosphate | 4151-51-3 | 2A-9030606 |
| 1-Chloro-3-ethoxy-2-propanol | 4151-98-8 | 2A-9030608 |
| 2-Ethyl-5-phenylisoxazolium-3'-sulfonate | 4156-16-5 | 2A-9030611 |
| Rose Bengal lactone | 4159-77-7 | 2A-9030612 |
| 4'-Methoxybutyrophenone | 4160-51-4 | 2A-9030613 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS