
CAS Number4146-30-9
SynonymsNeomycin B trisulfate; neomycin sulphate; Neohalicholactone; neomycin B sulfate; EINECS 223-969-3; Framycetin sulphate; neomycin trisulfate
Molecular FormulaC23H46N6O13.H2SO4
Molecular Weight712.72200
Purity98.00%
Boiling Point927.1ºC at 760 mmHg
AppearanceWhite to light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4146-30-9 |
| Catalog No. | 2A-9030602 |
| Chinese Name | 硫酸新霉素B |
| Synonyms | Neomycin B trisulfate; neomycin sulphate; Neohalicholactone; neomycin B sulfate; EINECS 223-969-3; Framycetin sulphate; neomycin trisulfate |
| Molecular Formula | C23H46N6O13.H2SO4 |
| Molecular Weight | 712.72200 |
| Purity | 98.00 |
| Boiling Point | 927.1ºC at 760 mmHg |
| Appearance | White to light yellow powder |
| Storage Condition | -20°C, protected from light, stored in inert gas |
| Application | Framycetin sulfate (Neomycin B sulfate) is an aminoglycoside antibiotic and a potent inhibitor of RNase P cleavage activity with a Ki of 35 μM. Framycetin sulfate competes for specific divalent metal |
| SMILES | NCC1OC(OC2C(CO)OC(OC3C(O)C(N)CC(N)C3OC3OC(CN)C(O)C(O)C3N)C2O)C(N)C(O)C1O.O=S(=O)(O)O |
| InChI | InChI=1S/C23H46N6O13.H2O4S/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22;1-5(2,3)4/h5-23,30-36H,1-4,24-29H2;(H2,1,2,3,4)/t5-,6+,7-,8-,9-,10-,11+,12+,13-,14+,15-,16+,17-,18-,19-,20-,21-,22+,23+;/m1./s1 |
| InChI Key | OIXVKQDWLFHVGR-WQDIDPJDSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/30602_1_4146_30_9.pdf |
| Transport Info | Product name: Neomycin B sulfate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| S-Butyl-D-cysteine | 4134-56-9 | 2A-9030593 |
| 2,4,6-Trichlorobenzoyl chloride | 4136-95-2 | 2A-9030595 |
| Methyl 3-aminopropanoate | 4138-35-6 | 2A-9030598 |
| cis-2-Phenyl-1,3-dioxan-5-ol | 4141-19-9 | 2A-9030600 |
| N-tert-Butylmaleimide | 4144-22-3 | 2A-9030601 |
| Potassium pyruvate | 4151-33-1 | 2A-9030604 |
| Tris(4-isocyanatophenyl) thiophosphate | 4151-51-3 | 2A-9030606 |
| 1-Chloro-3-ethoxy-2-propanol | 4151-98-8 | 2A-9030608 |
| 2-Ethyl-5-phenylisoxazolium-3'-sulfonate | 4156-16-5 | 2A-9030611 |
| Rose Bengal lactone | 4159-77-7 | 2A-9030612 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA