
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3943-77-9 |
| Catalog No. | 2A-9030315 |
| Chinese Name | 3,4-二甲氧基苯甲酸乙酯 |
| Synonyms | Ethyl 3,4-dimethoxybenzoate; MFCD00015150; EINECS 223-526-4 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.22600 |
| Purity | 98.00 |
| Density | 1.095g/cm3 |
| Boiling Point | 295.5ºC at 760mmHg |
| Melting Point | 43-44ºC |
| Storage Condition | Store at room temperature, away from light, in a v |
| HTC | 2918990090 |
| SMILES | CCOC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C11H14O4/c1-4-15-11(12)8-5-6-9(13-2)10(7-8)14-3/h5-7H,4H2,1-3H3 |
| InChI Key | AYYNUGSDPRDVCH-UHFFFAOYSA-N |
| MSDS | msds/30315_1_3943_77_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium chloroacetate; Chloroacetic acid sodium salt | 3926-62-3 | 2A-9030301 |
| 1,9-Nonanediol | 3937-56-2 | 2A-9030307 |
| Ethyl trimethylacetate | 3938-95-2 | 2A-9030308 |
| Ethyl methoxyacetate | 3938-96-3 | 2A-9030309 |
| Methyl vanillate | 3943-74-6 | 2A-9030314 |
| Isopropenylphosphonic dichloride | 3944-27-2 | 2A-9030318 |
| 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methyl morpholinium chloride | 3945-69-5 | 2A-9030319 |
| Monomethyl suberate | 3946-32-5 | 2A-9030321 |
| 4-Bromo-1(2H)-isoquinolone | 3951-95-9 | 2A-9030322 |
| Alizarin Fluorine Blue | 3952-78-1 | 2A-9030323 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA