
CAS Number3294-03-9
Synonyms2,2'-Thiobis(4-tert-octylphenol); Bis(2-hydroxy-5-tert-octylphenyl) Sulfide; EINECS 221-959-3; HOPS; Thiobisoctylphenol; MFCD00190577
Molecular FormulaC28H42O2S
Molecular Weight658.87
Purity99%
Density1.05g/cm3
Boiling Point524.8ºC at 760mmHg
Melting Point197-199 °C (lit.)
AppearanceSolid;White to Almost white powder to crystal
EINECS403-800-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3294-03-9 |
| Catalog No. | 2A-9029652 |
| Chinese Name | 2,2'-硫代(4-叔辛基苯酚) |
| Synonyms | 2,2'-Thiobis(4-tert-octylphenol); Bis(2-hydroxy-5-tert-octylphenyl) Sulfide; EINECS 221-959-3; HOPS; Thiobisoctylphenol; MFCD00190577 |
| Molecular Formula | C28H42O2S |
| Molecular Weight | 658.87 |
| Purity | 99 |
| Density | 1.05g/cm3 |
| Boiling Point | 524.8ºC at 760mmHg |
| Melting Point | 197-199 °C (lit.) |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Store at room temperature, away from light, in a v |
| EINECS | 403-800-1 |
| PubChem ID | 24865496 |
| MDL Number | MFCD01103222 |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Cc2cc(cc(c2O)-n3nc4ccccc4n3)C(C)(C)CC(C)(C)C)c(O)c(c1)-n5nc6ccccc6n5 |
| InChI | 1S/C41H50N6O2/c1-38(2,3)24-40(7,8)28-20-26(36(48)34(22-28)46-42-30-15-11-12-16-31(30)43-46)19-27-21-29(41(9,10)25-39(4,5)6)23-35(37(27)49)47-44-32-17-13-14-18-33(32)45-47/h11-18,20-23,48-49H,19,24-25H2,1-10H3 |
| InChI Key | FQUNFJULCYSSOP-UHFFFAOYSA-N |
| Beilstein/REAXYS | 11326835 |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/29652_1_3294_03_9.pdf |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 2,2'-Thio(4-tert-octylphenol) Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Didodecyldimethylammonium bromide | 3282-73-3 | 2A-9029634 |
| N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-phenylenediamine | 3283-07-6 | 2A-9029635 |
| Sulbutiamine | 3286-46-2 | 2A-9029639 |
| Benzylamine hydrochloride | 3287-99-8 | 2A-9029640 |
| 6-Amino-4-methoxy-2-methylthiouracil | 3289-53-0 | 2A-9029645 |
| Allyl octyl ether | 3295-97-4 | 2A-9029653 |
| 6-Carboxyfluorescein | 3301-79-9 | 2A-9029657 |
| delta-Nonalactone | 3301-94-8 | 2A-9029658 |
| 2-Aminobenzenesulfonamide | 3306-62-5 | 2A-9029664 |
| 2-(4-Chlorophenoxy)propionic acid | 3307-39-9 | 2A-9029665 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA