
CAS Number3111-37-3
Synonyms3-bromo-5-ethoxy4-hydroxy-benzaldehyde; 3-ethoxy-5-bromo-4-hydroxy-benzaldehyde; MFCD00173904; 5-bromobourbonal; 3-Aethoxy-5-brom-4-hydroxy-benzaldehyd
Molecular FormulaC9H9BrO3
Molecular Weight245.074
Purity98.00%
Density1.568g/cm3
Boiling Point303.8ºC at 760mmHg
Melting Point141-143°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3111-37-3 |
| Catalog No. | 2A-9029443 |
| Chinese Name | 3-溴-5-乙氧基-4-羟基苯甲醛 |
| Synonyms | 3-bromo-5-ethoxy4-hydroxy-benzaldehyde; 3-ethoxy-5-bromo-4-hydroxy-benzaldehyde; MFCD00173904; 5-bromobourbonal; 3-Aethoxy-5-brom-4-hydroxy-benzaldehyd |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.074 |
| Purity | 98.00 |
| Density | 1.568g/cm3 |
| Boiling Point | 303.8ºC at 760mmHg |
| Melting Point | 141-143°C |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2913000090 |
| PubChem ID | 3211105 |
| MDL Number | MFCD00173904 |
| SMILES | CCOc1cc(C=O)cc(Br)c1O |
| InChI | InChI=1S/C9H9BrO3/c1-2-13-8-4-6(5-11)3-7(10)9(8)12/h3-5,12H,2H2,1H3 |
| InChI Key | GWEFTCNMUHHQLP-UHFFFAOYSA-N |
| MSDS | msds/29443_1_3111_37_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(Trifluoromethyl)benzylamine | 3048-01-9 | 2A-9029354 |
| DL-alpha-Aminosuberic acid | 3054-07-7 | 2A-9029359 |
| Acrolein diethyl acetal | 3054-95-3 | 2A-9029360 |
| 1-Nonaneboronic acid | 3088-78-6 | 2A-9029421 |
| 3-(Trifluoromethyl)phenylhydrazine hydrochloride | 3107-33-3 | 2A-9029440 |
| Ammonium L-tartrate | 3164-29-2 | 2A-9029509 |
| Chloromethyl ethyl ether | 3188-13-4 | 2A-9029539 |
| 3-(Methylthio)propionaldehyde | 3268-49-3 | 2A-9029615 |
| Ethyl cyclohexanecarboxylate | 3289-28-9 | 2A-9029642 |
| 4-Methoxybenzhydrazide | 3290-99-1 | 2A-9029649 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA