
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3097-74-3 |
| Catalog No. | 2A-9029433 |
| Chinese Name | 3-甲氧基-2-甲基-3-氧代丙酸 |
| Synonyms | monomethyl 2-methylmalonate; methyl-malonic acid monomethyl ester; monomethyl methylmalonate; Methyl-malonsaeure-monomethylester |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 |
| Purity | 98.00 |
| Density | 1.205 g/cm3 |
| Boiling Point | 227.3ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 445644 |
| SMILES | COC(=O)C(C)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-3(4(6)7)5(8)9-2/h3H,1-2H3,(H,6,7) |
| InChI Key | LROWQPBZDXWPJW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dimethyl-4-nitrobenzoic acid | 3095-38-3 | 2A-9029428 |
| 2-Bromo-9-fluorenone | 3096-56-8 | 2A-9029429 |
| 4-Amino-3,5-xylenol | 3096-70-6 | 2A-0202097 |
| 4-Amino-2,5-dimethylphenol | 3096-71-7 | 2A-9029431 |
| 1,3-Dimethylbenzimidazol-2-one | 3097-21-0 | 2A-9029432 |
| 1-Methylcyclopropene | 3100-04-7 | 2A-9029435 |
| Tetrabutylammonium hexafluorophosphate | 3109-63-5 | 2A-9029442 |
| Methyl phenyl sulfone | 3112-85-4 | 2A-9029445 |
| 5-Methyl-2-nitrobenzoic acid | 3113-72-2 | 2A-9029447 |
| Chlorobenzene-D5 | 3114-55-4 | 2A-9029448 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA