
CAS Number3096-70-6
Synonyms4-Amino-3,5-xylenol; 4-Hydroxy-2,6-dimethylaniline; 3,5-Xylenol,4-amino; 2,6-dimethyl-4-hydroxyaniline; 4-Amino-3,5-dimethylphenol; 4-Amino-3,5-dimethyl-phenol; 3,5-dimethyl-4-amino phenol; 1,3-Dimethyl-2-amino-5-xylenol; MFCD01741459; EINECS 221-448-5
Molecular FormulaH2NC6H2(NO2)2CF3
Molecular Weight251.12
Purity97%
Density1.118g/cm3
Boiling Point296.5ºC at 760mmHg
Melting Point144-149 °C (lit.)
Appearancebrown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3096-70-6 |
| Catalog No. | 2A-0202097 |
| Chinese Name | 4-氨基-3,5-二甲苯酚 |
| Synonyms | 4-Amino-3,5-xylenol; 4-Hydroxy-2,6-dimethylaniline; 3,5-Xylenol,4-amino; 2,6-dimethyl-4-hydroxyaniline; 4-Amino-3,5-dimethylphenol; 4-Amino-3,5-dimethyl-phenol; 3,5-dimethyl-4-amino phenol; 1,3-Dimethyl-2-amino-5-xylenol; MFCD01741459; EINECS 221-448-5 |
| Molecular Formula | H2NC6H2(NO2)2CF3 |
| Molecular Weight | 251.12 |
| Purity | 97 |
| Density | 1.118g/cm3 |
| Boiling Point | 296.5ºC at 760mmHg |
| Melting Point | 144-149 °C (lit.) |
| Appearance | brown solid |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2922299090 |
| PubChem ID | 24879619 |
| MDL Number | MFCD00024260 |
| SMILES | Nc1c(cc(cc1[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O |
| InChI | 1S/C7H4F3N3O4/c8-7(9,10)3-1-4(12(14)15)6(11)5(2-3)13(16)17/h1-2H,11H2 |
| InChI Key | VACNDKUQVLNNLD-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/29430_1_3096_70_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetra-tert-butyl orthotitanate | 3087-39-6 | 2A-9029418 |
| Sodium 2-(2-dodecyloxyethoxy)ethyl sulphate | 3088-31-1 | 2A-9029419 |
| Halcinonide | 3093-35-4 | 2A-9029424 |
| 3,5-Dimethyl-4-nitrobenzoic acid | 3095-38-3 | 2A-9029428 |
| 2-Bromo-9-fluorenone | 3096-56-8 | 2A-9029429 |
| 4-Amino-2,5-dimethylphenol | 3096-71-7 | 2A-9029431 |
| 1,3-Dimethylbenzimidazol-2-one | 3097-21-0 | 2A-9029432 |
| 3-Methoxy-2-methyl-3-oxopropanoic acid | 3097-74-3 | 2A-9029433 |
| 1-Methylcyclopropene | 3100-04-7 | 2A-9029435 |
| Tetrabutylammonium hexafluorophosphate | 3109-63-5 | 2A-9029442 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA