
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3080-29-3 |
| Catalog No. | 2A-9029404 |
| Chinese Name | L-腺苷 |
| Synonyms | MFCD01075784 |
| Molecular Formula | C10H13O4N5 |
| Molecular Weight | 267.24 |
| Purity | 98.00 |
| Density | 2.085 g/cm3 |
| Boiling Point | 676.271ºC at 760 mmHg |
| Melting Point | 257.0-257.5ºC (0.4 H2O) |
| Storage Condition | 2-8℃ |
| Application | L-adenosine is a metabolically stable enantiomeric analogue and a potential probe. L-adenosine has weak inhibitory adenosine deaminase (ADA) activity with a Ki value of 385 μM. L-adenosine can be used |
| PubChem ID | 3726994 |
| MDL Number | MFCD01075784 |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13) |
| InChI Key | OIRDTQYFTABQOQ-DEGSGYPDSA-N |
| MSDS | msds/29404_1_3080_29_3.pdf |
| Transport Info | Product name: L-adenosine |
| Related Products in Biotechnology & Diagnostics | ||
|---|---|---|
| Dihydronicotinamide-adenine dinucleotide phosphate tetrasodium salt | 2646-71-1 | 2A-9028862 |
| Boc-L-serine methyl ester | 2766-43-0 | 2A-9028990 |
| N-Boc-L-alpha-phenylglycine | 2900-27-8 | 2A-9029157 |
| 2'-Deoxyadenosine-5'-monophosphate disodium salt | 2922-74-9 | 2A-9029195 |
| 2'-Fluoro-2'-deoxythymidine | 2923-73-1 | 2A-9029201 |
| N-Cbz-L-Isoleucine | 3160-59-6 | 2A-9029503 |
| N'-Boc-L-2,4-diaminobutyric acid methyl ester hydrochloride | 3350-15-0 | 2A-9029702 |
| Boc-L-alanine N-succinimidyl ester | 3392-05-0 | 2A-9029748 |
| Boc-glycine-N-hydroxysuccinimide ester | 3392-07-2 | 2A-9029749 |
| Boc-L-tryptophan N-hydroxysuccinimide ester | 3392-11-8 | 2A-9029750 |
| Browse all Biotechnology & Diagnostics products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA