CAS Number3061-36-7
Synonyms4-phenoxydiphenyl ether; p-Diphenoxybenzene; MFCD00038368; 1,4-Diphenoxybenzene; 1,4-Diphenoxy-benzol; p-Phenoxyphenoxybenzene; diphenoxy benzene; 4-Phenoxydiphenyl oxide; Benzene,p-diphenoxy; Hydroquinone Diphenyl Ether; 1,4-diphenoxy-benzene; Benzene,1,4-diphenoxy; Di-O-phenyl-hydrochinon
Molecular FormulaC18H14O2
Molecular Weight262.31
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point370.8±25.0 °C at 760 mmHg
Melting Point73-77 °C
AppearanceOff-white to light brown tablets or pills
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3061-36-7 |
| Catalog No. | 2A-9029371 |
| Chinese Name | 1,4-二苯氧基苯 |
| Synonyms | 4-phenoxydiphenyl ether; p-Diphenoxybenzene; MFCD00038368; 1,4-Diphenoxybenzene; 1,4-Diphenoxy-benzol; p-Phenoxyphenoxybenzene; diphenoxy benzene; 4-Phenoxydiphenyl oxide; Benzene,p-diphenoxy; Hydroquinone Diphenyl Ether; 1,4-diphenoxy-benzene; Benzene,1,4-diphenoxy; Di-O-phenyl-hydrochinon |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 370.8±25.0 °C at 760 mmHg |
| Melting Point | 73-77 °C |
| Appearance | Off-white to light brown tablets or pills |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2909309090 |
| PubChem ID | 3154601 |
| MDL Number | MFCD00038368 |
| SMILES | O(c1ccccc1)c2ccc(Oc3ccccc3)cc2 |
| InChI | InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H |
| InChI Key | InChIKey=UVGPELGZPWDPFP-UHFFFAOYSA-N |
| MSDS | msds/29371_1_3061_36_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dodecylheptaglycol | 3055-97-8 | 2A-9029361 |
| L-Aspartic acid 4-tert-butyl ester | 3057-74-7 | 2A-9029364 |
| 3-Methyladipic acid | 3058-01-3 | 2A-9029365 |
| D(-)-Isovaline | 3059-97-0 | 2A-9029367 |
| 3-Amino-4-phenylbutyric acid hydrochloride | 3060-41-1 | 2A-9029368 |
| Docosanamide | 3061-75-4 | 2A-9029372 |
| 3,5-Bis(tert-butyl)-4-hydroxybenzenepropanoyl chloride | 3062-64-4 | 2A-9029374 |
| Diisobutylthiuram disulfide | 3064-73-1 | 2A-9029375 |
| 3,3'-Diethyl-9-methylthiacarbocyanine iodide | 3065-79-0 | 2A-9029376 |
| Cyclohexyl acrylate | 3066-71-5 | 2A-9029378 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS