
CAS Number34052-37-4
Synonyms2-chloro-5-nitrophenyl phenyl ketone; 2-Chlor-5-nitro-benzophenon; 5-Nitro-2-chlorobenzophenone; EINECS 251-811-3; MFCD00007295; 2-Chloro-5-nitrobenzophenone; 2-chloro-5-nitro-benzophenone; (2-Chloro-5-nitrophenyl)(phenyl)methanone
Molecular Formula5-(Cl)-2-(CH3)C6H3NH2
Molecular Weight141.60
Purity≥98.0 (GC)%
Density1.4±0.1 g/cm3
Boiling Point237 °C/1013 hPa
Melting Point22 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34052-37-4 |
| Catalog No. | 2A-9002919 |
| Chinese Name | 2-氯-5-硝基二苯甲酮 |
| Synonyms | 2-chloro-5-nitrophenyl phenyl ketone; 2-Chlor-5-nitro-benzophenon; 5-Nitro-2-chlorobenzophenone; EINECS 251-811-3; MFCD00007295; 2-Chloro-5-nitrobenzophenone; 2-chloro-5-nitro-benzophenone; (2-Chloro-5-nitrophenyl)(phenyl)methanone |
| Molecular Formula | 5-(Cl)-2-(CH3)C6H3NH2 |
| Molecular Weight | 141.60 |
| Purity | ≥98.0 (GC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 237 °C/1013 hPa |
| Melting Point | 22 °C |
| Appearance | solid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2914700090 |
| MDL Number | MFCD00007779 |
| SMILES | Clc1cc(c(cc1)C)N |
| InChI | 1S/C7H8ClN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| InChI Key | WRZOMWDJOLIVQP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352116 |
| MSDS | msds/2919_1_34052_37_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-fluoronitrobenzene | 345-17-5 | 2A-9002906 |
| 2-Chloro-5-hydroxybenzotrifluoride | 6294-93-5 | 2A-9002910 |
| 2'-Chloro-5'-nitroacetophenone | 23082-50-0 | 2A-9002915 |
| 2-Chloro-5-nitroanisole | 1009-36-5 | 2A-9002916 |
| 2-Chloro-5-nitrobenzonitrile | 16588-02-6 | 2A-9002918 |
| 2-Chloro-5-nitrobenzotrifluoride | 777-37-7 | 2A-9002921 |
| 2-Chloro-5-nitrophenol | 619-10-3 | 2A-9002922 |
| 2-Chloro-6-fluoro-3-methylbenzoic acid | 32890-89-4 | 2A-9002931 |
| 2-Chloro-6-fluoro-3-methylbenzoyl chloride | 261762-82-7 | 2A-9002932 |
| 2-Chloro-6-fluoro-3-methylbenzyl alcohol | 261762-83-8 | 2A-9002933 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA