
CAS Number23082-50-0
Synonyms1-(2-chloro-5-nitrophenyl)ethan-1-one; MFCD00052836; 5-nitro-1-(2-chlorophenyl)ethanone; Ethanone,1-(2-chloro-5-nitrophenyl); 1-Acetyl-2-chloro-5-nitrobenzene; 1-(2-Chloro-5-nitrophenyl)ethanone; EINECS 245-421-2
Molecular FormulaClC6H2(OH)(NO2)COCH3
Molecular Weight215.59
Purity99%
Density1.4±0.1 g/cm3
Boiling Point244.8±20.0 °C at 760 mmHg
Melting Point132-135 °C (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23082-50-0 |
| Catalog No. | 2A-9002915 |
| Chinese Name | 2-氯-5-硝基苯乙酮 |
| Synonyms | 1-(2-chloro-5-nitrophenyl)ethan-1-one; MFCD00052836; 5-nitro-1-(2-chlorophenyl)ethanone; Ethanone,1-(2-chloro-5-nitrophenyl); 1-Acetyl-2-chloro-5-nitrobenzene; 1-(2-Chloro-5-nitrophenyl)ethanone; EINECS 245-421-2 |
| Molecular Formula | ClC6H2(OH)(NO2)COCH3 |
| Molecular Weight | 215.59 |
| Purity | 99 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 244.8±20.0 °C at 760 mmHg |
| Melting Point | 132-135 °C (lit.) |
| Storage Condition | Room temperature, dry |
| HTC | 2914700090 |
| PubChem ID | 24866033 |
| MDL Number | MFCD00191921 |
| SMILES | CC(=O)c1cc(Cl)cc(c1O)[N+]([O-])=O |
| InChI | 1S/C8H6ClNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 |
| InChI Key | IUNBIQBAYUBIFD-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/2915_1_23082_50_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-fluorobenzoic acid | 2252-50-8 | 2A-9002903 |
| 2-Chloro-5-fluorobenzonitrile | 57381-56-3 | 2A-9002904 |
| 2-Chloro-5-fluorobenzotrifluoride | 89634-75-3 | 2A-9002905 |
| 2-Chloro-5-fluoronitrobenzene | 345-17-5 | 2A-9002906 |
| 2-Chloro-5-hydroxybenzotrifluoride | 6294-93-5 | 2A-9002910 |
| 2-Chloro-5-nitroanisole | 1009-36-5 | 2A-9002916 |
| 2-Chloro-5-nitrobenzonitrile | 16588-02-6 | 2A-9002918 |
| 2-Chloro-5-nitrobenzophenone | 34052-37-4 | 2A-9002919 |
| 2-Chloro-5-nitrobenzotrifluoride | 777-37-7 | 2A-9002921 |
| 2-Chloro-5-nitrophenol | 619-10-3 | 2A-9002922 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA