
CAS Number237761-77-2
Synonyms2-Chloro-5-(trifluoromethyl)benzyl bromide; MFCD00236216; α-Bromo-2-chloro-5-(trifluoromethyl)toluene; 2-(Bromomethyl)-1-chloro-4-(trifluoromethyl)benzene; FXFFR DG C1E
Molecular FormulaC8H5Cl1Br1F3
Molecular Weight273.48
Purity97%
Density1.7±0.1 g/cm3
Boiling Point225.7±35.0 °C at 760 mmHg
Appearanceyellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 237761-77-2 |
| Catalog No. | 2A-9002892 |
| Chinese Name | 2-氯-5(三氟甲基)苄溴 |
| Synonyms | 2-Chloro-5-(trifluoromethyl)benzyl bromide; MFCD00236216; α-Bromo-2-chloro-5-(trifluoromethyl)toluene; 2-(Bromomethyl)-1-chloro-4-(trifluoromethyl)benzene; FXFFR DG C1E |
| Molecular Formula | C8H5Cl1Br1F3 |
| Molecular Weight | 273.48 |
| Purity | 97 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 225.7±35.0 °C at 760 mmHg |
| Appearance | yellow liquid |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| Packaging | III |
| HTC | 2903999090 |
| MDL Number | MFCD00236216 |
| SMILES | FC(F)(F)c1ccc(Cl)c(CBr)c1 |
| InChI | InChI=1S/C8H5BrClF3/c9-4-5-3-6(8(11,12)13)1-2-7(5)10/h1-3H,4H2 |
| InChI Key | BWOOBQYXRVOJSZ-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/2892_1_237761_77_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-4-hydroxybenzaldehyde | 56962-11-9 | 2A-9002873 |
| 2'-Chloro-5'-(trifluoromethyl)acetophenone | 71648-45-8 | 2A-9002888 |
| 2-Chloro-5-(trifluoromethyl)benzeneboronic acid | 182344-18-9 | 2A-9002889 |
| 2-Chloro-5-(trifluoromethyl)benzenesulphonylchloride | 54090-08-3 | 2A-9002890 |
| 2-Chloro-5-(trifluoromethyl)benzoyl chloride | 657-05-6 | 2A-9002891 |
| 2-Chloro-5-(trifluoromethyl)benzylamine | 15996-78-8 | 2A-9002893 |
| 2-Chloro-5-(trifluoromethyl)phenylacetic acid | 22893-39-6 | 2A-9002894 |
| 2-Chloro-5-(trifluoromethyl)phenylacetonitrile | 22902-88-1 | 2A-9002895 |
| 2-Chloro-5-(trifluoromethyl)phenylhydrazine | 1869-22-3 | 2A-9002896 |
| 2-Chloro-5-nitrobenzaldehyde | 6361-21-3 | 2A-9002917 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA