
CAS Number657-05-6
SynonymsGVR BG EXFFF; 2-Chloro-5-(trifluoromethyl)benzoyl chloride; JRD-0979; 2-chloro-5-trifluoromethylbenzoyl chloride; MFCD01631634; 2-Chlor-5-trifluormethyl-benzoylchlorid; 6-Chloro-α,α,α-trifluoro-m-toluoyl chloride; 2-Chlor-5-trifluormethyl-benzoesaeure-chlorid
Molecular FormulaC8H3O1Cl2F3
Molecular Weight243.01
Purity97%
Density1.5±0.1 g/cm3
Boiling Point235.4±40.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 657-05-6 |
| Catalog No. | 2A-9002891 |
| Chinese Name | 2-氯-5-(三氟甲基)苯甲酰氯 |
| Synonyms | GVR BG EXFFF; 2-Chloro-5-(trifluoromethyl)benzoyl chloride; JRD-0979; 2-chloro-5-trifluoromethylbenzoyl chloride; MFCD01631634; 2-Chlor-5-trifluormethyl-benzoylchlorid; 6-Chloro-α,α,α-trifluoro-m-toluoyl chloride; 2-Chlor-5-trifluormethyl-benzoesaeure-chlorid |
| Molecular Formula | C8H3O1Cl2F3 |
| Molecular Weight | 243.01 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 235.4±40.0 °C at 760 mmHg |
| Storage Condition | Store in a container filled with dry inert gas and |
| Packaging | II |
| HTC | 2916399090 |
| MDL Number | MFCD01631634 |
| SMILES | O=C(Cl)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C8H3Cl2F3O/c9-6-2-1-4(8(11,12)13)3-5(6)7(10)14/h1-3H |
| InChI Key | FRARPACTAFPNNL-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/2891_1_657_05_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-4-fluorophenylboronic acid | 313545-72-1 | 2A-9002866 |
| 2-Chloro-4-hydroxybenzaldehyde | 56962-11-9 | 2A-9002873 |
| 2'-Chloro-5'-(trifluoromethyl)acetophenone | 71648-45-8 | 2A-9002888 |
| 2-Chloro-5-(trifluoromethyl)benzeneboronic acid | 182344-18-9 | 2A-9002889 |
| 2-Chloro-5-(trifluoromethyl)benzenesulphonylchloride | 54090-08-3 | 2A-9002890 |
| 2-Chloro-5-(trifluoromethyl)benzyl bromide | 237761-77-2 | 2A-9002892 |
| 2-Chloro-5-(trifluoromethyl)benzylamine | 15996-78-8 | 2A-9002893 |
| 2-Chloro-5-(trifluoromethyl)phenylacetic acid | 22893-39-6 | 2A-9002894 |
| 2-Chloro-5-(trifluoromethyl)phenylacetonitrile | 22902-88-1 | 2A-9002895 |
| 2-Chloro-5-(trifluoromethyl)phenylhydrazine | 1869-22-3 | 2A-9002896 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA