
CAS Number2565-47-1
Synonyms1-methyl-2,4,6-pyrimidinetrione; N-Me barbituric acid; 1-methyl-1,3,5-trihydropyrimidine-2,4,6-trione; 1-methylpyrimidine-(1H,3H,5H)-2,4,6-trione; N-METHYLBARBITURIC ACID; 1-Methyl barbituric acid; methylbarbituric acid; 1-Methyl-2,4,6(1H,3H,5H)-pyrimidinetrione; 1-Methylpyrimidine-2,4,6(1H,3H,5H)-trione
Molecular FormulaC5H6O3N2
Molecular Weight142.11
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point279.7ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2565-47-1 |
| Catalog No. | 2A-9028751 |
| Chinese Name | 1-甲基巴比妥酸 |
| Synonyms | 1-methyl-2,4,6-pyrimidinetrione; N-Me barbituric acid; 1-methyl-1,3,5-trihydropyrimidine-2,4,6-trione; 1-methylpyrimidine-(1H,3H,5H)-2,4,6-trione; N-METHYLBARBITURIC ACID; 1-Methyl barbituric acid; methylbarbituric acid; 1-Methyl-2,4,6(1H,3H,5H)-pyrimidinetrione; 1-Methylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Molecular Formula | C5H6O3N2 |
| Molecular Weight | 142.11 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 279.7ºC at 760mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933540000 |
| PubChem ID | 120554 |
| MDL Number | MFCD00127915 |
| SMILES | CN1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O3/c1-7-4(9)2-3(8)6-5(7)10/h2H2,1H3,(H,6,8,10) |
| InChI Key | DCGGMHIZEAHUJL-UHFFFAOYSA-N |
| MSDS | msds/28751_1_2565_47_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diflorasone | 2557-49-5 | 2A-9028743 |
| 3-[(4-Fluorophenyl)methylene]phthalide | 2558-18-1 | 2A-9028746 |
| 3-Fluorophenylacetylene | 2561-17-3 | 2A-9028747 |
| 4,5-Dibromo-1,2-benzenediol | 2563-26-0 | 2A-9028748 |
| 2,2,6,6-Tetramethylpiperidinooxy | 2564-83-2 | 2A-9028750 |
| Cbz-Gly-Gly | 2566-19-0 | 2A-9028752 |
| Tetraethylammonium perchlorate | 2567-83-1 | 2A-9028756 |
| 2,4,6-Trimethoxybenzonitrile | 2571-54-2 | 2A-9028761 |
| Diisopropyl chlorophosphate | 2574-25-6 | 2A-9028762 |
| 2-Bromoethylamine hydrobromide | 2576-47-8 | 2A-9028765 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA