
CAS Number261762-45-2
Synonyms1-(2-Chloro-3,6-difluorophenyl)methanamine; 2-Chloro-3,6-difluorobenzenemethanamine; MFCD01631449; 2-Chloro-3,6-difluorobenzylamine; Z1R BG CF FF; 1-(2-Chloro-3,6-difluorophenyl)methylamine; (2-Chloro-3,6-difluorophenyl)methylamine; (2-Chloro-3,6-difluorophenyl)methanamine
Molecular FormulaC15H14ClNO
Molecular Weight259.738
Purity97%
Density1.4±0.1 g/cm3
Boiling Point210.3±35.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-45-2 |
| Catalog No. | 2A-9002809 |
| Chinese Name | 2-氯-3,6-二氟苄胺 |
| Synonyms | 1-(2-Chloro-3,6-difluorophenyl)methanamine; 2-Chloro-3,6-difluorobenzenemethanamine; MFCD01631449; 2-Chloro-3,6-difluorobenzylamine; Z1R BG CF FF; 1-(2-Chloro-3,6-difluorophenyl)methylamine; (2-Chloro-3,6-difluorophenyl)methylamine; (2-Chloro-3,6-difluorophenyl)methanamine |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.738 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 210.3±35.0 °C at 760 mmHg |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| Packaging | III |
| HTC | 2921499090 |
| MDL Number | MFCD00028419 |
| SMILES | NCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C7H6ClF2N/c8-7-4(3-11)5(9)1-2-6(7)10/h1-2H,3,11H2 |
| InChI Key | KDAQEMQCJMFSEP-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/2809_1_261762_45_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-3,5-difluoroaniline | 36556-60-2 | 2A-9002801 |
| 2-Chloro-3,5-dinitrobenzotrifluoride | 392-95-0 | 2A-9002803 |
| 2-Chloro-3,6-difluorobenzoic acid | 287172-74-1 | 2A-9002806 |
| 2-Chloro-3,6-difluorobenzoyl chloride | 261762-42-9 | 2A-9002807 |
| 2-Chloro-3,6-difluorobenzyl bromide | 90292-67-4 | 2A-9002808 |
| 2-Chloro-3-fluorobenzonitrile | 874781-08-5 | 2A-9002814 |
| 2-Chloro-3-fluoromethylbenzoic acid | 916791-84-9 | 2A-9002816 |
| 2-Chloro-3-fluoronitrobenzene | 21397-07-9 | 2A-9002817 |
| 2-Chloro-3-hydroxybenzotrifluoride | 138377-34-1 | 2A-9002819 |
| 2-Chloro-4-(trifluoromethoxy)aniline | 69695-61-0 | 2A-9002827 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA