
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 287172-74-1 |
| Catalog No. | 2A-9002806 |
| Chinese Name | 2-氯-3,6-二氟苯甲酸 |
| Synonyms | 2-chloro-3,6-difluoro-benzoic Acid; MFCD01631441 |
| Molecular Formula | C7H3ClF2O2 |
| Molecular Weight | 192.54700 |
| Purity | 97 |
| Density | 1.573g/cm3 |
| Boiling Point | 126-128°C |
| Melting Point | 126-128°C |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2916399090 |
| SMILES | O=C(O)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
| InChI Key | COWJYTLVSFKOPM-UHFFFAOYSA-N |
| MSDS | msds/2806_1_287172_74_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-2-nitroacetanilide | 10147-70-3 | 2A-9002792 |
| 2-Chloro-3,3,3-trifluoroprop-1-ene | 2730-62-3 | 2A-9002798 |
| 2-Chloro-3,4-difluoronitrobenzene | 169468-83-1 | 2A-9002799 |
| 2-Chloro-3,5-difluoroaniline | 36556-60-2 | 2A-9002801 |
| 2-Chloro-3,5-dinitrobenzotrifluoride | 392-95-0 | 2A-9002803 |
| 2-Chloro-3,6-difluorobenzoyl chloride | 261762-42-9 | 2A-9002807 |
| 2-Chloro-3,6-difluorobenzyl bromide | 90292-67-4 | 2A-9002808 |
| 2-Chloro-3,6-difluorobenzylamine | 261762-45-2 | 2A-9002809 |
| 2-Chloro-3-fluorobenzonitrile | 874781-08-5 | 2A-9002814 |
| 2-Chloro-3-fluoromethylbenzoic acid | 916791-84-9 | 2A-9002816 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA