
CAS Number2116-65-6
SynonymsMFCD00006443; (phenyl)(4-pyridyl)methane; 4-Benzyl-pyridine; EINECS 218-319-0; para-benzylpyridine; phenyl-(4-pyridinyl)methane; p-benzylpyridine; Pyridine,4-benzyl; Pyridine,4-(phenylmethyl)
Molecular FormulaC12H11N
Molecular Weight169.22
Purity98.00%
Density1.061 g/mL at 25 °C(lit.)
Boiling Point287 °C(lit.)
Melting Point9-11 °C
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2116-65-6 |
| Catalog No. | 2A-9028007 |
| Chinese Name | 4-苄基吡啶 |
| Synonyms | MFCD00006443; (phenyl)(4-pyridyl)methane; 4-Benzyl-pyridine; EINECS 218-319-0; para-benzylpyridine; phenyl-(4-pyridinyl)methane; p-benzylpyridine; Pyridine,4-benzyl; Pyridine,4-(phenylmethyl) |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.22 |
| Purity | 98.00 |
| Density | 1.061 g/mL at 25 °C(lit.) |
| Boiling Point | 287 °C(lit.) |
| Melting Point | 9-11 °C |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | The storage place must be away from oxidants, keep |
| Packaging | I; II; III |
| HTC | 29333999 |
| PubChem ID | 73788 |
| SMILES | c1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C12H11N/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-9H,10H2 |
| InChI Key | DBOLXXRVIFGDTI-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Nitropyrazole | 2075-46-9 | 2A-9027946 |
| Methyl 3-methyl-2-benzofurancarboxylate | 2076-36-0 | 2A-9027947 |
| 8-Hydroxyquinoline aluminum salt | 2085-33-8 | 2A-9027959 |
| 2-Mercapto-4-phenylthiazole | 2103-88-0 | 2A-9027978 |
| 2-Amino-4-(4-chlorophenyl)thiazole | 2103-99-3 | 2A-9027980 |
| 2,2'-Dithiodipyridine | 2127-03-9 | 2A-9028017 |
| (2S)-2-Piperidinecarboxylic acid hydrochloride | 2133-33-7 | 2A-9028026 |
| 2-Amino-5-(2-chlorophenyl)-1,3,4-oxadiazole | 2138-98-9 | 2A-9028034 |
| 1,3-Dihydro-1-(1,2,3,6-tetrahydro-4-pyridinyl)-2H-benzimidazole-2-one | 2147-83-3 | 2A-9028054 |
| 4,7-Dichloroquinazoline | 2148-57-4 | 2A-9028056 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA