
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2103-99-3 |
| Catalog No. | 2A-9027980 |
| Chinese Name | 2-氨基-4-(4-氯苯基)噻唑 |
| Synonyms | 2-Amino-4-(4-chlorophenyl)thiazole; F 1654; 4-(4-Chlorophenyl)thiazol-2-amine; MFCD00047058 |
| Molecular Formula | C9H7ClN2S |
| Molecular Weight | 221.24 |
| Purity | 96 |
| Density | 1.389 g/cm3 |
| Boiling Point | 389.8ºC at 760 mmHg |
| Melting Point | 283-287 °C |
| Appearance | solid |
| Storage Condition | The storage place must be away from oxidants, keep |
| HTC | 2934100090 |
| PubChem ID | 24884358 |
| MDL Number | MFCD00170222 |
| SMILES | Nc1nc(cs1)-c2ccc(cc2)[N+]([O-])=O |
| InChI | 1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14/h1-5H,(H2,10,11) |
| InChI Key | RIKJWJIWXCUKQV-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/27980_1_2103_99_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Bromopyrazole | 2075-45-8 | 2A-9027945 |
| 4-Nitropyrazole | 2075-46-9 | 2A-9027946 |
| Methyl 3-methyl-2-benzofurancarboxylate | 2076-36-0 | 2A-9027947 |
| 8-Hydroxyquinoline aluminum salt | 2085-33-8 | 2A-9027959 |
| 2-Mercapto-4-phenylthiazole | 2103-88-0 | 2A-9027978 |
| 4-Benzylpyridine | 2116-65-6 | 2A-9028007 |
| 2,2'-Dithiodipyridine | 2127-03-9 | 2A-9028017 |
| (2S)-2-Piperidinecarboxylic acid hydrochloride | 2133-33-7 | 2A-9028026 |
| 2-Amino-5-(2-chlorophenyl)-1,3,4-oxadiazole | 2138-98-9 | 2A-9028034 |
| 1,3-Dihydro-1-(1,2,3,6-tetrahydro-4-pyridinyl)-2H-benzimidazole-2-one | 2147-83-3 | 2A-9028054 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA