
CAS Number2039-66-9
SynonymsEINECS 218-016-3; 2-hydroxyphenylethylamine; 2-hydrophenethylamine; phenolethylamine; o-tyramine; 2-(2-Aminoethyl)phenol; o-hydroxyphenylethylamine; 2-Hydroxyphenethylamine; 2-tyramine; o-Hydroxyphenethylamine
Molecular FormulaC8H11NO
Molecular Weight137.18
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point258.0±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2039-66-9 |
| Catalog No. | 2A-9027855 |
| Chinese Name | 2-(2-氨基乙基)苯酚 |
| Synonyms | EINECS 218-016-3; 2-hydroxyphenylethylamine; 2-hydrophenethylamine; phenolethylamine; o-tyramine; 2-(2-Aminoethyl)phenol; o-hydroxyphenylethylamine; 2-Hydroxyphenethylamine; 2-tyramine; o-Hydroxyphenethylamine |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 258.0±15.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 3154385 |
| SMILES | NCCc1ccccc1O |
| InChI | InChI=1S/C8H11NO/c9-6-5-7-3-1-2-4-8(7)10/h1-4,10H,5-6,9H2 |
| InChI Key | FMEVAQARAVDUNY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Iodo-2-naphthol | 2033-42-3 | 2A-9027842 |
| 5-Chloro-1,3-dihydrobenzoimidazol-2-one | 2034-23-3 | 2A-9027846 |
| 4-Benzoyl-3-hydroxyphenyl methacrylate | 2035-72-5 | 2A-9027847 |
| 2-Deoxystreptamine dihydrobromide | 2037-48-1 | 2A-9027850 |
| Carsalam | 2037-95-8 | 2A-9027851 |
| 3-Methoxyphenethylamine | 2039-67-0 | 2A-9027856 |
| 4-Dimethylaminostyrene | 2039-80-7 | 2A-9027857 |
| 4-Bromostyrene | 2039-82-9 | 2A-9027858 |
| 3-Chlorostyrene | 2039-85-2 | 2A-9027859 |
| 3-Bromostyrene | 2039-86-3 | 2A-9027860 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA