
CAS Number2035-72-5
Synonyms2-Hydroxy-4-benzoylphenylmethacrylat; 3-Hydroxy-4-(phenylcarbonyl)phenyl-2-methylprop-2-enoat; 3-Hydroxy-4-benzoylphenylester v. Metacrylsaeure; EINECS 218-000-6; 4-methacryloxy-2-hydroxy-benzophenone; MFCD00080561; 2-methyl-2-propenoic acid,4-benzoyl-3-hydroxyphenyl ester; 3-hydroxy-4-(phenylcarbonyl)phenyl 2-methylprop-2-enoate; 2-Propenoic acid, 2-methyl-, 4-benzoyl-3-hydroxyphenyl ester; 4-Benzoyl-3-hydroxyphenyl methacrylate
Molecular FormulaC17H14O4
Molecular Weight282.29
Purity≥99%
Density1.2±0.1 g/cm3
Boiling Point437.4±38.0 °C at 760 mmHg
Melting Point77-79°C
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2035-72-5 |
| Catalog No. | 2A-9027847 |
| Chinese Name | 2-羟基-4-(甲基丙烯酰氧基)二苯甲酮 |
| Synonyms | 2-Hydroxy-4-benzoylphenylmethacrylat; 3-Hydroxy-4-(phenylcarbonyl)phenyl-2-methylprop-2-enoat; 3-Hydroxy-4-benzoylphenylester v. Metacrylsaeure; EINECS 218-000-6; 4-methacryloxy-2-hydroxy-benzophenone; MFCD00080561; 2-methyl-2-propenoic acid,4-benzoyl-3-hydroxyphenyl ester; 3-hydroxy-4-(phenylcarbonyl)phenyl 2-methylprop-2-enoate; 2-Propenoic acid, 2-methyl-, 4-benzoyl-3-hydroxyphenyl ester; 4-Benzoyl-3-hydroxyphenyl methacrylate |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 |
| Purity | ≥99 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 437.4±38.0 °C at 760 mmHg |
| Melting Point | 77-79°C |
| Appearance | liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| PubChem ID | 6646631 |
| MDL Number | MFCD00080561 |
| SMILES | O(c1cc(c(cc1)C(=O)c2ccccc2)O)C(=O)C(=C)C |
| InChI | 1S/C17H14O4/c1-11(2)17(20)21-13-8-9-14(15(18)10-13)16(19)12-6-4-3-5-7-12/h3-10,18H,1H2,2H3 |
| InChI Key | IMNBHNRXUAJVQE-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 43211915 |
| MSDS | msds/27847_1_2035_72_5.pdf |
| Transport Info | Product name: 2-hydroxy-4-(methacryloyloxy)benzophenone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Benzyl-N-propylamine | 2032-33-9 | 2A-9027837 |
| 3,3-Diethoxypropionitrile | 2032-34-0 | 2A-9027838 |
| Mercaptodimethur | 2032-65-7 | 2A-9027840 |
| 1-Iodo-2-naphthol | 2033-42-3 | 2A-9027842 |
| 5-Chloro-1,3-dihydrobenzoimidazol-2-one | 2034-23-3 | 2A-9027846 |
| 2-Deoxystreptamine dihydrobromide | 2037-48-1 | 2A-9027850 |
| Carsalam | 2037-95-8 | 2A-9027851 |
| 2-(2-Aminoethyl)phenol | 2039-66-9 | 2A-9027855 |
| 3-Methoxyphenethylamine | 2039-67-0 | 2A-9027856 |
| 4-Dimethylaminostyrene | 2039-80-7 | 2A-9027857 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA