
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1917-15-3 |
| Catalog No. | 2A-9027683 |
| Chinese Name | 5-甲基-2-糠酸 |
| Synonyms | 5-Methyl-2-furoic acid; 5-methylfuran-2-carboxylic acid; MFCD00092359 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.110 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 236.9±20.0 °C at 760 mmHg |
| Melting Point | 136-137°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2932190090 |
| PubChem ID | 92570 |
| SMILES | Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C6H6O3/c1-4-2-3-5(9-4)6(7)8/h2-3H,1H3,(H,7,8) |
| InChI Key | OVOCLWJUABOAPL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-tert-Butyl N-[(tert-butoxy)carbonyl]-L-aspartate dicyclohexylamine salt | 1913-12-8 | 2A-9027675 |
| trans-Styrylacetic acid | 1914-58-5 | 2A-9027677 |
| Chlorophosphonazo III | 1914-99-4 | 2A-9027680 |
| Methyl 3,4,5-trimethoxybenzoate | 1916-07-0 | 2A-9027681 |
| 3-Hydroxy-4,5-dimethoxybenzoic acid | 1916-08-1 | 2A-9027682 |
| Tetrabutylammonium perchlorate | 1923-70-2 | 2A-9027690 |
| DL-Homoserine | 1927-25-9 | 2A-9027691 |
| 4-Methoxycinnamic acid ethyl ester | 1929-30-2 | 2A-9027695 |
| Mordant Red 19 | 1934-24-3 | 2A-9027700 |
| Sodium dicyanamide | 1934-75-4 | 2A-9027701 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA