
CAS Number1916-08-1
SynonymsMFCD00002508; 5-Hydroxy veratric acid; 3-hydroxy-4,5-dimethoxy-benzoic acid; EINECS 217-630-9; 4,5-dimethoxy-3-hydroxybenzoic acid; 3,4-O-dimethylgallic acid; 3.4-Dimethyl-gallussaeure; 5-Hydroxy-3,4-dimethoxybenzoic acid; 3,4-Dimethoxy-5-hydroxybenzoic acid; 3-Hydroxy-4,5-dimethoxy-benzoesaeure
Molecular FormulaC9H10O5
Molecular Weight198.18
Purity98.00%
Melting Point197-198°C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1916-08-1 |
| Catalog No. | 2A-9027682 |
| Chinese Name | 5-羟基-3,4-二甲氧基苯甲酸 |
| Synonyms | MFCD00002508; 5-Hydroxy veratric acid; 3-hydroxy-4,5-dimethoxy-benzoic acid; EINECS 217-630-9; 4,5-dimethoxy-3-hydroxybenzoic acid; 3,4-O-dimethylgallic acid; 3.4-Dimethyl-gallussaeure; 5-Hydroxy-3,4-dimethoxybenzoic acid; 3,4-Dimethoxy-5-hydroxybenzoic acid; 3-Hydroxy-4,5-dimethoxy-benzoesaeure |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.18 |
| Purity | 98.00 |
| Melting Point | 197-198°C |
| Appearance | solid |
| Storage Condition | Sealed, store at 2 ºC -8 ºC |
| HTC | 2918990090 |
| PubChem ID | 82648 |
| SMILES | COc1cc(C(=O)O)cc(O)c1OC |
| InChI | InChI=1S/C9H10O5/c1-13-7-4-5(9(11)12)3-6(10)8(7)14-2/h3-4,10H,1-2H3,(H,11,12) |
| InChI Key | WFIBQVFJXGQICQ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-(2-bromo-1H-indol-3-yl)acetate | 1912-35-2 | 2A-9027674 |
| 4-tert-Butyl N-[(tert-butoxy)carbonyl]-L-aspartate dicyclohexylamine salt | 1913-12-8 | 2A-9027675 |
| trans-Styrylacetic acid | 1914-58-5 | 2A-9027677 |
| Chlorophosphonazo III | 1914-99-4 | 2A-9027680 |
| Methyl 3,4,5-trimethoxybenzoate | 1916-07-0 | 2A-9027681 |
| 5-Methyl-2-furoic acid | 1917-15-3 | 2A-9027683 |
| Tetrabutylammonium perchlorate | 1923-70-2 | 2A-9027690 |
| DL-Homoserine | 1927-25-9 | 2A-9027691 |
| 4-Methoxycinnamic acid ethyl ester | 1929-30-2 | 2A-9027695 |
| Mordant Red 19 | 1934-24-3 | 2A-9027700 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA