
CAS Number1774-35-2
SynonymsDi-p-tolyl sulfoxide; 4,4'-Sulfinylbis(methylbenzene); 1,1'-Sulfinylbis(4-methylbenzene); 4,4'-Ditolyl sulfoxide; di-(4-methylphenyl)sulfoxide; p-Tolyl Sulfoxide; 4,4'-Dimethyldiphenylsulphoxide; Bis(4-methylphenyl) sulfoxide; MFCD00008546; Bis(p-tolyl)sulphoxide; EINECS 217-203-7; Ditolyl sulfoxide; Ditolyl sulphoxide; 4,4'-dimethyldiphenyl sulphoxide; Sulfoxide,ditolyl; 4,4'-Dimethyldiphenylsulfoxide
Molecular Formula(CH3C6H4)2SO
Molecular Weight230.33
Purity97%
Density1.2±0.1 g/cm3
Boiling Point378.3±31.0 °C at 760 mmHg
Melting Point94-96 °C (lit.)
AppearanceSolid;White to Almost white powder to crystal
EINECS217-203-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1774-35-2 |
| Catalog No. | 2A-9027449 |
| Chinese Name | 4,4'-二甲苯亚砜 |
| Synonyms | Di-p-tolyl sulfoxide; 4,4'-Sulfinylbis(methylbenzene); 1,1'-Sulfinylbis(4-methylbenzene); 4,4'-Ditolyl sulfoxide; di-(4-methylphenyl)sulfoxide; p-Tolyl Sulfoxide; 4,4'-Dimethyldiphenylsulphoxide; Bis(4-methylphenyl) sulfoxide; MFCD00008546; Bis(p-tolyl)sulphoxide; EINECS 217-203-7; Ditolyl sulfoxide; Ditolyl sulphoxide; 4,4'-dimethyldiphenyl sulphoxide; Sulfoxide,ditolyl; 4,4'-Dimethyldiphenylsulfoxide |
| Molecular Formula | (CH3C6H4)2SO |
| Molecular Weight | 230.33 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 378.3±31.0 °C at 760 mmHg |
| Melting Point | 94-96 °C (lit.) |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| EINECS | 217-203-7 |
| HTC | 2930909090 |
| PubChem ID | 24900205 |
| MDL Number | MFCD00008546 |
| SMILES | Cc1ccc(cc1)S(=O)c2ccc(C)cc2 |
| InChI | 1S/C14H14OS/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChI Key | MJWNJEJCQHNDNM-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/27449_1_1774_35_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Guanidine phosphate | 1763-07-1 | 2A-9027439 |
| 2,3,4,5,6-Pentafluorobenzyl bromide | 1765-40-8 | 2A-9027440 |
| 4-Chlorotetrahydro-2H-pyran | 1768-64-5 | 2A-9027442 |
| 2,3-Dimethyl-3H-quinazolin-4-one | 1769-25-1 | 2A-9027444 |
| 6-Methoxy-2-phenyltetralone | 1769-84-2 | 2A-9027445 |
| Bis(4-methoxyphenyl) sulfoxide | 1774-36-3 | 2A-9027450 |
| Trimethylsulfoxonium iodide | 1774-47-6 | 2A-9027451 |
| 2-Bromo-1-indanone | 1775-27-5 | 2A-9027452 |
| Ethynyltriethylsilane | 1777-03-3 | 2A-9027455 |
| Phenylphosphinic acid | 1779-48-2 | 2A-9027460 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA