
CAS Number1769-84-2
Synonyms6-methoxy-2-phenyl-tetralone; 6-Methoxy-2-phenyl-3,4-dihydro-1(2H)-naphthalenone; 6-Methoxy-2-phenyl-3,4-dihydronaphthalen-1(2H)-one; 6-methoxy-2-phenyl-1-tetralone; 2-phenyl-6-methoxytetralone
Molecular FormulaC17H16O2
Molecular Weight252.31
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point429.9±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1769-84-2 |
| Catalog No. | 2A-9027445 |
| Chinese Name | 6-甲氧基-2-苯基四氢萘酮 |
| Synonyms | 6-methoxy-2-phenyl-tetralone; 6-Methoxy-2-phenyl-3,4-dihydro-1(2H)-naphthalenone; 6-Methoxy-2-phenyl-3,4-dihydronaphthalen-1(2H)-one; 6-methoxy-2-phenyl-1-tetralone; 2-phenyl-6-methoxytetralone |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 429.9±45.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2914509090 |
| PubChem ID | 15790275 |
| SMILES | COc1ccc2c(c1)CCC(c1ccccc1)C2=O |
| InChI | InChI=1S/C17H16O2/c1-19-14-8-10-16-13(11-14)7-9-15(17(16)18)12-5-3-2-4-6-12/h2-6,8,10-11,15H,7,9H2,1H3 |
| InChI Key | XSTDIWNKASNIET-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,4'-Diaminodicyclohexyl methane | 1761-71-3 | 2A-9027434 |
| Guanidine phosphate | 1763-07-1 | 2A-9027439 |
| 2,3,4,5,6-Pentafluorobenzyl bromide | 1765-40-8 | 2A-9027440 |
| 4-Chlorotetrahydro-2H-pyran | 1768-64-5 | 2A-9027442 |
| 2,3-Dimethyl-3H-quinazolin-4-one | 1769-25-1 | 2A-9027444 |
| 4,4'-Dimethyldiphenylsulfoxide | 1774-35-2 | 2A-9027449 |
| Bis(4-methoxyphenyl) sulfoxide | 1774-36-3 | 2A-9027450 |
| Trimethylsulfoxonium iodide | 1774-47-6 | 2A-9027451 |
| 2-Bromo-1-indanone | 1775-27-5 | 2A-9027452 |
| Ethynyltriethylsilane | 1777-03-3 | 2A-9027455 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA