
CAS Number1713-15-1
SynonymsIsobutyl 2,4-D; 2-methylpropyl (2,4-dichlorophenoxy)acetate; Acetic acid,(2,4-dichlorophenoxy)-,2-methylpropyl ester; (2,4-dichloro-phenoxy)-acetic acid isobutyl ester; isobutyl (2,4-dichlorophenoxy)acetate; EINECS 216-992-5; MFCD00072476; (2,4-Dichlor-phenoxy)-essigsaeure-isobutylester; 2,4-D Iso butyl ester; Isobutyl 2,4-dichlorophenoxyacetate; Caswell No. 315AR; 2-methylpropyl 2-(2,4-dichlorophenoxy)acetate
Molecular FormulaC12H14Cl2O3
Molecular Weight277.14400
Purity98.00%
Density1.238g/cm3
Boiling Point338.2ºC at 760mmHg
Melting Point7ºC
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1713-15-1 |
| Catalog No. | 2A-9027341 |
| Chinese Name | 2,4-滴异丁酯 |
| Synonyms | Isobutyl 2,4-D; 2-methylpropyl (2,4-dichlorophenoxy)acetate; Acetic acid,(2,4-dichlorophenoxy)-,2-methylpropyl ester; (2,4-dichloro-phenoxy)-acetic acid isobutyl ester; isobutyl (2,4-dichlorophenoxy)acetate; EINECS 216-992-5; MFCD00072476; (2,4-Dichlor-phenoxy)-essigsaeure-isobutylester; 2,4-D Iso butyl ester; Isobutyl 2,4-dichlorophenoxyacetate; Caswell No. 315AR; 2-methylpropyl 2-(2,4-dichlorophenoxy)acetate |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.14400 |
| Purity | 98.00 |
| Density | 1.238g/cm3 |
| Boiling Point | 338.2ºC at 760mmHg |
| Melting Point | 7ºC |
| Packaging | III |
| HTC | 2918990090 |
| PubChem ID | 479186 |
| SMILES | CC(C)COC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O3/c1-8(2)6-17-12(15)7-16-11-4-3-9(13)5-10(11)14/h3-5,8H,6-7H2,1-2H3 |
| InChI Key | GPSGZZSRFJXXBA-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3,6-Di(2-pyridyl)-1,2,4,5-tetrazine | 1671-87-0 | 2A-9027247 |
| 2,4-Dihydroxyquinoline | 1677-36-7 | 2A-9027257 |
| 6-Fluoro-2,4-dihydroxyquinoline | 1677-37-8 | 2A-9027258 |
| 2,4-Dimethylcinnamic acid | 1685-80-9 | 2A-9027279 |
| 2,4-Dichloro-6-phenyl-1,3,5-triazine | 1700-02-3 | 2A-9027306 |
| 2,4,5-Triiodoimidazole | 1746-25-4 | 2A-9027408 |
| L-2,4-Diaminobutyric acid hydrobromine | 1758-80-1 | 2A-9027427 |
| L-2,4-Diaminobutyric acid dihydrochloride | 1883-09-6 | 2A-9027632 |
| 2,4-Diaminoquinazoline | 1899-48-5 | 2A-9027659 |
| Paraquat dichloride | 1910-42-5 | 2A-9027671 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA