
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1711-34-8 |
| Catalog No. | 2A-9027338 |
| Chinese Name | 4-甲基环己烷甲酸苯酯 |
| Synonyms | 4-methylcyclohexanecarboxylic acid phenyl ester |
| Molecular Formula | C12H9ClO3S |
| Molecular Weight | 268.721 |
| Purity | 98.00 |
| HTC | 2916209090 |
| PubChem ID | 54424009 |
| MDL Number | MFCD00193266 |
| SMILES | CC1CCC(C(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C14H18O2/c1-11-7-9-12(10-8-11)14(15)16-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3 |
| InChI Key | RUDYNVVHAQTPQV-UHFFFAOYSA-N |
| MSDS | msds/27338_1_1711_34_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Chloromethylbiphenyl | 1667-11-4 | 2A-9027232 |
| 10-(3-Chloropropyl)-2-(trifluoromethyl)-10H-phenothiazine | 1675-46-3 | 2A-9027251 |
| Dimethyl cyclohexane-1,2-dicarboxylate | 1687-29-2 | 2A-9027281 |
| 3-Benzyloxybenzaldehyde | 1700-37-4 | 2A-9027308 |
| 1,2,3,4-Butanetetracarboxylic acid | 1703-58-8 | 2A-9027319 |
| Chloro(chloromethyl)dimethylsilane | 1719-57-9 | 2A-0201668 |
| 2-(Trifluoromethyl)phenylthiourea | 1736-71-6 | 2A-9027386 |
| Cyclopropanecarboxylic acid | 1759-53-1 | 2A-9027429 |
| 5-Bromosalicylaldehyde | 1761-61-1 | 2A-9027432 |
| 2-Hydroxy-5-iodobenzaldehyde | 1761-62-2 | 2A-9027433 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA